CAS 2743-38-6: L-Dibenzoyltartaric acid
Description:L-Dibenzoyltartaric acid, with the CAS number 2743-38-6, is an organic compound that belongs to the class of tartaric acid derivatives. It is characterized by the presence of two benzoyl groups attached to the tartaric acid backbone, which contributes to its unique properties. This compound typically appears as a white to off-white crystalline solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. L-Dibenzoyltartaric acid is known for its chiral nature, making it useful in asymmetric synthesis and as a chiral auxiliary in various chemical reactions. It has applications in the pharmaceutical industry, particularly in the synthesis of enantiomerically pure compounds. Additionally, it can act as a stabilizing agent in certain formulations. The compound's melting point and specific optical rotation can vary, reflecting its purity and crystalline form. Overall, L-Dibenzoyltartaric acid is a valuable compound in organic chemistry and synthesis due to its structural features and reactivity.
Formula:C18H14O8
InChI:InChI=1S/C18H14O8/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h1-10,13-14H,(H,19,20)(H,21,22)/t13-,14-/m1/s1
InChI key:InChIKey=YONLFQNRGZXBBF-ZIAGYGMSSA-N
SMILES:O=C(O)C(OC(=O)C=1C=CC=CC1)C(OC(=O)C=2C=CC=CC2)C(=O)O
- Synonyms:
- (-)-2,3-Dibenzoyl-<span class="text-smallcaps">L</span>-tartaric acid
- (-)-<span class="text-smallcaps">L</span>-Dibenzoyltartaric acid
- (-)-Dibenzoyl-(L)-tartaric acid anhydrous
- (-)-Dibenzoyl-<span class="text-smallcaps">L</span>-tartaric acid
- (-)-Dibenzoyltartaric acid
- (-)-O,O′-Dibenzoyl-<span class="text-smallcaps">L</span>-tartaric acid
- (-)-O,O′-Dibenzoyltartaric acid
- (2R,3R)-2,3-Bis(benzoyloxy)succinic acid
- (2R,3R)-2,3-bis(benzoyloxy)butanedioate
- (2R,3R)-2,3-bis(benzoyloxy)butanedioic acid
- See more synonyms
- (2R,3R)-2,3-bis[(phenylcarbonyl)oxy]butanedioic acid
- (2R,3R)-Di-O-benzoyltartaric acid
- (2R,3R)-O,O′-Dibenzoyltartaric acid
- (2R,3S)-2,3-bis(benzoyloxy)butanedioate
- (2S,3S)-2,3-bis(benzoyloxy)butanedioate
- (2S,3S)-2,3-bis(benzoyloxy)succinic acid
- (R,R)-2,3-Dibenzoyloxysuccinic acid
- (R,R)-O,O′-Dibenzoyltartaric acid
- 2,3-Di-O-benzoyl-<span class="text-smallcaps">L</span>-tartaric acid
- Butanedioic acid, 2,3-bis(benzoyloxy)-, (2R,3R)-
- Butanedioic acid, 2,3-bis(benzoyloxy)-, [R-(R*,R*)]-
- Dibenzoyl-(+)-tartaric acid
- Dibenzoyl-L-(-)-Tartaric Acid
- Dibenzoyl-L-tartric acid
- L(+)Dibenzoyltartric Acid
- L-Dbta
- NSC 118224
- NSC 338494
- O,O-Dibenzoyl-(R,R)-tartaric acid
- O,O′-Dibenzoyl-(+)-tartaric acid
- O,O′-Dibenzoyl-(2R,3R)-tartaric acid
- O<sup>2</sup>,O<sup>3</sup>-Dibenzoyl-<span class="text-smallcaps">L</span>-tartaric acid
- Tartaric acid, dibenzoate
