CAS 27430-18-8

5-(furan-2-ylmethylidene)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione

Description:

5-(Furan-2-ylmethylidene)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione, with the CAS number 27430-18-8, is a heterocyclic compound characterized by its unique structural features, including a pyrimidine ring fused with a thioxo group and a furan moiety. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its structure suggests potential reactivity due to the presence of the thioxo group, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The furan ring contributes to the compound's aromaticity and may enhance its interaction with biological targets. Additionally, the presence of multiple functional groups allows for diverse chemical modifications, which can lead to the development of derivatives with improved pharmacological properties. Overall, this compound's unique characteristics make it a valuable subject for research in drug development and organic synthesis.

Formula: C₉H₆N₂O₃S

InChI: InChI=1/C9H6N2O3S/c12-7-6(4-5-2-1-3-14-5)8(13)11-9(15)10-7/h1-4H,(H2,10,11,12,13,15)

SMILES: c1cc(C=C2C(=NC(=S)N=C2O)O)oc1

Synonyms:

• 2(5H)-pyrimidinethione, 5-(2-furanylmethylene)-4,6-dihydroxy-
• 4,6(1H,5H)-Pyrimidinedione, 5-(2-furanylmethylene)dihydro-2-thioxo-
• 5-(2-Furylmethylene)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione
• 5-(2-Furylmethylidene)-2-Thioxohexahydropyrimidine-4,6-Dione

CD00509

CAS: 27430-18-8

CD00509

Purity: ≥95%

Molecular weight: 222.22g/mol

Ref: 54-BUP05899

CD00509

CAS: 27430-18-8

CD00509 is a tyrosyl-DNA phosphodiesterase inhibitor.

Formula: C₉H₆N₂O₃S

Purity: 99.95%

Color and Shape: Solid

Molecular weight: 222.22

Ref: TM-T50033

CD00509

CAS: 27430-18-8

Purity: 98%

Molecular weight: 222.01

Ref: 10-F555073

5-[(Furan-2-yl)methylidene]-4,6-dihydroxy-2,5-dihydropyrimidine-2-thione

CAS: 27430-18-8

Versatile small molecule scaffold

Formula: C₉H₆N₂O₃S

Purity: Min. 95%

Molecular weight: 222.22 g/mol

Ref: 3D-CBA43018