CAS 27434-98-6

4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methylene]-, (E)-

Description:

4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methylene]-, (E)-, also known by its CAS number 27434-98-6, is a synthetic organic compound characterized by its complex structure that includes a benzopyran core, hydroxyl groups, and methoxy substituents. This compound exhibits properties typical of flavonoids, which are known for their antioxidant activity and potential health benefits. The presence of multiple hydroxyl groups enhances its reactivity and solubility in polar solvents, while the methoxy groups contribute to its stability and lipophilicity. The (E)- configuration indicates a specific geometric arrangement around the double bond in the molecule, which can influence its biological activity and interaction with other substances. This compound may be of interest in pharmaceutical research due to its potential therapeutic applications, including anti-inflammatory and anticancer properties, although further studies would be necessary to fully elucidate its biological effects and mechanisms of action.

Formula: C₁₈H₁₆O₆

InChI: InChI=1S/C18H16O6/c1-22-12-5-3-10(4-6-12)7-11-9-24-18-15(16(11)21)13(19)8-14(20)17(18)23-2/h3-8,19-20H,9H2,1-2H3/b11-7+

InChI key: InChIKey=ZQTVKHLRTZRJSM-YRNVUSSQSA-N

SMILES: O=C\1C=2C(=C(OC)C(O)=CC2O)OC/C1=C\C3=CC=C(OC)C=C3

Synonyms:

• 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methylene]-, (E)-
• 4-Chromanone, 5,7-dihydroxy-8-methoxy-3-(p-methoxybenzylidene)-, (E)-

4'-O-Methylpunctatin

CAS: 27434-98-6

4'-O-Methylpunctatin is a specialized natural product, classified as a methoxyflavone, which is derived from specific plant sources known for their diverse phytochemical compositions. Structurally, it is a derivative of punctatin, modified through methylation, enhancing its biological properties and stability. This compound acts through various mechanisms, primarily influencing glucose metabolism pathways. It exhibits inhibitory effects on enzymes like α-glucosidase and provides antioxidant properties that protect pancreatic β-cells from oxidative stress.

Formula: C₁₈H₁₆O₆

Purity: Min. 95%

Molecular weight: 328.32 g/mol

Ref: 3D-XM161959