CAS 2744-17-4
:diethyl (pyridin-3-ylmethanediyl)biscarbamate
Description:
Diethyl (pyridin-3-ylmethanediyl)biscarbamate, with the CAS number 2744-17-4, is an organic compound characterized by its structure, which includes two carbamate functional groups linked by a pyridine-derived moiety. This compound typically exhibits properties associated with carbamates, such as being a potential inhibitor of certain enzymes or biological processes. It is likely to be a solid at room temperature, with moderate solubility in polar organic solvents due to the presence of the carbamate groups. The pyridine ring contributes to its aromatic character, which can influence its reactivity and interaction with biological systems. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and agricultural applications. Safety data should be consulted for handling and potential toxicity, as carbamates can vary widely in their effects. Overall, diethyl (pyridin-3-ylmethanediyl)biscarbamate represents a class of compounds with diverse applications and significant chemical properties.
Formula:C12H17N3O4
InChI:InChI=1/C12H17N3O4/c1-3-18-11(16)14-10(15-12(17)19-4-2)9-6-5-7-13-8-9/h5-8,10H,3-4H2,1-2H3,(H,14,16)(H,15,17)
SMILES:CCOC(=NC(c1cccnc1)N=C(O)OCC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Diethyl N,N-(3’-Pyridylmethylene)bis(carbamate)
CAS:Formula:C12H17N3O4Color and Shape:SolidMolecular weight:267.2811Diethyl N,N-(3’-Pyridylmethylene)bis(carbamate)
CAS:Controlled ProductApplications Diethyl N,N-(3’-Pyridylmethylene)bis(carbamate) (cas# 2744-17-4) is a compound useful in organic synthesis.
Formula:C12H17N3O4Color and Shape:NeatMolecular weight:267.28

