CAS 2745-17-7
:2-oxiran-2-ylfuran
Description:
2-Oxiran-2-ylfuran, also known by its CAS number 2745-17-7, is an organic compound characterized by the presence of both an epoxide (oxirane) and a furan ring in its structure. The epoxide group contributes to its reactivity, making it a potential intermediate in various chemical reactions, particularly in the synthesis of more complex molecules. The furan moiety adds to its aromatic character and can influence its electronic properties. This compound is typically a colorless to pale yellow liquid, exhibiting a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the epoxide group makes it susceptible to nucleophilic attack, which can lead to ring-opening reactions under appropriate conditions. 2-Oxiran-2-ylfuran may find applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its unique structural features and reactivity. Safety precautions should be taken when handling this compound, as epoxides can be irritants and potentially hazardous.
Formula:C6H6O2
InChI:InChI=1/C6H6O2/c1-2-5(7-3-1)6-4-8-6/h1-3,6H,4H2
SMILES:c1cc(C2CO2)oc1
Synonyms:- (±)-2-(Epoxyethyl)furan
- 2-(Oxiran-2-yl)furan
- 2745-17-7
- Furan, 2-Oxiranyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(oxiran-2-yl)furan
CAS:Controlled Product<p>Applications 2-(oxiran-2-yl)furan (cas# 2745-17-7) is a useful research chemical.<br></p>Formula:C6H6O2Color and Shape:Dark YellowMolecular weight:110.11
