CAS 2745-26-8
:2-Furanacetic acid
Description:
2-Furanacetic acid, with the CAS number 2745-26-8, is an organic compound characterized by its furan ring structure attached to an acetic acid moiety. This compound features a five-membered aromatic ring containing oxygen, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. 2-Furanacetic acid is known for its potential applications in pharmaceuticals and as a building block in organic synthesis due to its reactivity and ability to participate in various chemical reactions, such as esterification and amidation. The presence of both the furan and carboxylic acid functional groups allows for diverse interactions, making it a versatile compound in chemical research. Additionally, it may exhibit biological activity, which is of interest in medicinal chemistry. However, like many organic acids, it should be handled with care due to potential irritant properties. Overall, 2-Furanacetic acid is a valuable compound in both industrial and research settings.
Formula:C6H6O3
InChI:InChI=1S/C6H6O3/c7-6(8)4-5-2-1-3-9-5/h1-3H,4H2,(H,7,8)
InChI key:InChIKey=VYSRZETUSAOIMP-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=CO1
Synonyms:- 2-(2-Furyl)acetic acid
- 2-(Furan-2-yl)acetic acid
- 2-Furanacetic acid
- 2-Furanylacetic acid
- 2-Furylacetic acid
- 3-(Furan-2-Yl)Propanoic Acid
- Furan-2-Ylacetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Furan-2-yl)acetic acid
CAS:2-(Furan-2-yl)acetic acid is a furan derivative widely used in biochemical experiments and drug synthesis research.Formula:C6H6O3Purity:98.74%Color and Shape:SolidMolecular weight:126.112-(Furan-2-yl)acetic Acid
CAS:Formula:C6H6O3Purity:>98.0%(GC)(T)Color and Shape:White to Yellow powder to crystalMolecular weight:126.112-(Furan-2-yl)acetic acid
CAS:Formula:C6H6O3Purity:95.0%Color and Shape:Solid, Crystalline Powder or Flakes or PowderMolecular weight:126.1112-(Furan-2-yl)acetic Acid
CAS:Controlled ProductApplications 2-(Furan-2-yl)acetic Acid is one of the compounds detected in tobacco smoke condensate.
References Schumacher, J., et al.: J. Agric. Food Chem., 25, 310 (1977);Formula:C6H6O3Color and Shape:NeatMolecular weight:126.11





