CymitQuimica logo

CAS 27452-68-2

:

3-[2-[4-[2-[4-[(2-Cyanoethyl)ethylamino]-2-methylphenyl]diazenyl]-1-naphthalenyl]diazenyl]benzenesulfonic acid

Description:
3-[2-[4-[2-[4-[(2-Cyanoethyl)ethylamino]-2-methylphenyl]diazenyl]-1-naphthalenyl]diazenyl]benzenesulfonic acid, with CAS number 27452-68-2, is a complex organic compound characterized by its azo dye structure, which features multiple diazenyl groups. This compound typically exhibits vibrant colors due to the presence of conjugated double bonds, making it useful in various dye applications. It is soluble in polar solvents, which enhances its utility in aqueous systems. The sulfonic acid group contributes to its water solubility and can also influence its reactivity and interaction with other chemical species. The presence of cyanoethyl and ethylamino groups suggests potential for further chemical modifications, which can be exploited in synthetic chemistry. Additionally, the compound may exhibit specific optical properties, making it of interest in fields such as materials science and dye chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with azo compounds and their degradation products.
Formula:C28H26N6O3S
InChI:InChI=1S/C28H26N6O3S/c1-3-34(17-7-16-29)22-12-13-26(20(2)18-22)31-33-28-15-14-27(24-10-4-5-11-25(24)28)32-30-21-8-6-9-23(19-21)38(35,36)37/h4-6,8-15,18-19H,3,7,17H2,1-2H3,(H,35,36,37)
InChI key:InChIKey=UFXBCNONMFYXGQ-UHFFFAOYSA-N
SMILES:N(=NC1=CC(S(=O)(=O)O)=CC=C1)C=2C3=C(C(N=NC4=C(C)C=C(N(CCC#N)CC)C=C4)=CC2)C=CC=C3
Synonyms:
  • 3-[2-[4-[2-[4-[(2-Cyanoethyl)ethylamino]-2-methylphenyl]diazenyl]-1-naphthalenyl]diazenyl]benzenesulfonic acid
  • Benzenesulfonic acid, m-[[4-[[4-[(2-cyanoethyl)ethylamino]-o-tolyl]azo]-1-naphthyl]azo]-
  • Benzenesulfonic acid, 3-[[4-[[4-[(2-cyanoethyl)ethylamino]-2-methylphenyl]azo]-1-naphthalenyl]azo]-
  • Benzenesulfonic acid, 3-[2-[4-[2-[4-[(2-cyanoethyl)ethylamino]-2-methylphenyl]diazenyl]-1-naphthalenyl]diazenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.