
CAS 274677-98-4
:(2β,3β,4α)-28-(β-D-Glucopyranosyloxy)-2-hydroxy-23,28-dioxoolean-12-en-3-yl β-D-glucopyranosiduronic acid
Description:
The chemical substance known as "(2β,3β,4α)-28-(β-D-Glucopyranosyloxy)-2-hydroxy-23,28-dioxoolean-12-en-3-yl β-D-glucopyranosiduronic acid," with the CAS number 274677-98-4, is a complex glycosylated triterpenoid compound. It features multiple functional groups, including hydroxyl and uronic acid moieties, which contribute to its solubility and reactivity. The presence of glucopyranosyl units indicates that it is a glycoside, which may enhance its biological activity and interaction with various biological systems. This compound is derived from oleanolic acid, a naturally occurring triterpene, and exhibits potential pharmacological properties, including anti-inflammatory and antioxidant activities. Its structural complexity suggests that it may interact with cellular pathways, making it of interest in medicinal chemistry and pharmacology. The specific stereochemistry and functional groups play a crucial role in determining its biological activity and therapeutic potential. Further studies would be necessary to elucidate its mechanisms of action and potential applications in health and disease.
Formula:C42H64O16
InChI:InChI=1S/C42H64O16/c1-37(2)11-13-42(36(54)58-34-29(50)26(47)25(46)22(17-43)55-34)14-12-40(5)19(20(42)15-37)7-8-24-38(3)16-21(45)32(39(4,18-44)23(38)9-10-41(24,40)6)57-35-30(51)27(48)28(49)31(56-35)33(52)53/h7,18,20-32,34-35,43,45-51H,8-17H2,1-6H3,(H,52,53)/t20-,21-,22+,23+,24+,25+,26-,27-,28-,29+,30+,31-,32-,34-,35-,38-,39-,40+,41+,42-/m0/s1
InChI key:InChIKey=QUKCKUMUBOPETR-RQBYSGHOSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)([C@@](C=O)(C)[C@@H](O[C@@H]7O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)C6)[H])[H])(CC(C)(C)CC3)[H]
Synonyms:- β-D-Glucopyranosiduronic acid, (2β,3β,4α)-28-(β-D-glucopyranosyloxy)-2-hydroxy-23,28-dioxoolean-12-en-3-yl
- Oleragenoside
- (2β,3β,4α)-28-(β-D-Glucopyranosyloxy)-2-hydroxy-23,28-dioxoolean-12-en-3-yl β-D-glucopyranosiduronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Oleragenoside
CAS:<p>Oleragenoside is a useful organic compound for research related to life sciences. The catalog number is T125142 and the CAS number is 274677-98-4.</p>Formula:C42H64O16Color and Shape:SolidMolecular weight:824.958
