CAS 274694-98-3
:7-methyl-6,7,8,9,14,15-hexahydro-5H-indolo[3,2-f][3]benzazecine
Description:
7-methyl-6,7,8,9,14,15-hexahydro-5H-indolo[3,2-f][3]benzazecine is a complex organic compound characterized by its unique bicyclic structure, which incorporates both indole and benzazecine moieties. This compound features multiple fused rings, contributing to its rigidity and potential biological activity. The presence of a methyl group at the 7-position enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. The hexahydro configuration indicates that the compound is saturated in certain regions, which can affect its reactivity and stability. As a member of the indole family, it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The specific arrangement of atoms and functional groups within the molecule can lead to diverse interactions in biological systems, potentially impacting its efficacy as a therapeutic agent. Overall, this compound's structural complexity and potential biological significance warrant further investigation in the fields of organic chemistry and pharmacology.
Formula:C20H22N2
InChI:InChI=1/C20H22N2/c1-22-12-10-15-6-2-3-7-16(15)14-20-18(11-13-22)17-8-4-5-9-19(17)21-20/h2-9,21H,10-14H2,1H3
SMILES:CN1CCc2ccccc2Cc2c(CC1)c1ccccc1[nH]2
Synonyms:- 5H-Indolo[3,2-f][3]benzazecine, 6,7,8,9,14,15-hexahydro-7-methyl-
- 7-Methyl-6,7,8,9,14,15-hexahydro-5H-indolo[3,2-f][3]benzazecine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
LE 300
CAS:LE 300 represents a structurally novel type of antagonists acting preferentially at the dopamine D(1)/D(5)receptors and the serotonin 5-HT(2A)receptor.Formula:C20H22N2Purity:97.91% - 98.79%Color and Shape:SolidMolecular weight:290.4LE 300
CAS:Controlled ProductApplications LE 300 is a potent and selective dopamine receptor antagonist.
References Hefnawy, M., et al.: Luminescence, 31, 63-66 (2016)Formula:C20H22N2Color and Shape:NeatMolecular weight:290.4LE 300
CAS:LE 300 is a cutting-edge biopesticide, which is derived from naturally occurring microbial sources. This formulation exploits the bioactive compounds produced by specific microorganisms to disrupt the physiological processes of target pests. The mode of action involves the inhibition of essential metabolic pathways, leading to the eventual mortality of these pests. This mechanism makes it an effective tool in integrated pest management programs that aim to minimize chemical pesticide use.Formula:C20H22N2Purity:Min. 95%Molecular weight:290.41 g/mol




