CAS 2747-04-8
:4-(bromomethyl)umbelliferyl acetate
Description:
4-(Bromomethyl)umbelliferyl acetate, with the CAS number 2747-04-8, is a chemical compound that belongs to the class of umbelliferone derivatives. It is characterized by the presence of a bromomethyl group attached to the umbelliferone structure, which is a coumarin derivative known for its fluorescent properties. This compound typically exhibits a white to pale yellow crystalline appearance and is soluble in organic solvents such as ethanol and acetone, but less soluble in water. The bromomethyl group enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the acetate moiety contributes to its stability and solubility profile. 4-(Bromomethyl)umbelliferyl acetate is often utilized in biochemical applications, particularly in fluorescence assays and as a substrate for studying enzyme activity, due to its ability to release umbelliferone upon hydrolysis. Its unique structural features and reactivity make it a valuable compound in organic synthesis and biochemical research.
Formula:C12H9BrO4
InChI:InChI=1/C12H9BrO4/c1-7(14)16-9-2-3-10-8(6-13)4-12(15)17-11(10)5-9/h2-5H,6H2,1H3
SMILES:CC(=O)Oc1ccc2c(cc(=O)oc2c1)CBr
Synonyms:- 7-Acetoxy-4-(Bromomethyl)Coumarin
- 4-(bromomethyl)-2-oxo-2H-chromen-7-yl acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Acetoxy-4-bromomethylcoumarin [for HPLC Labeling]
CAS:Formula:C12H9BrO4Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:297.107-Acetoxy-4-bromomethylcoumarin
CAS:Formula:C12H9BrO4Purity:98%Color and Shape:SolidMolecular weight:297.10157-Acetoxy-4-bromomethylcoumarin
CAS:7-Acetoxy-4-bromomethylcoumarin serves as a fluorescent label for fatty acids.Formula:C12H9BrO4Color and Shape:SolidMolecular weight:297.14-Bromomethyl-7-acetoxycoumarin
CAS:Controlled ProductApplications A fluorescent reagent used for labelling carboxylic acids.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C12H9BrO4Color and Shape:NeatMolecular weight:297.1




