CAS 27472-15-7

3-[(2-methoxyphenyl)amino]propanenitrile

Description:

3-[(2-Methoxyphenyl)amino]propanenitrile, with the CAS number 27472-15-7, is an organic compound characterized by its structure, which includes a propanenitrile backbone substituted with a 2-methoxyphenylamino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in organic solvents due to the presence of the methoxy group, which can enhance its lipophilicity. The nitrile functional group (-C≡N) contributes to its reactivity, allowing for potential participation in nucleophilic addition reactions. Additionally, the amino group (-NH-) can engage in hydrogen bonding, influencing its physical properties such as melting and boiling points. The presence of the methoxy group may also affect the compound's electronic properties, potentially making it a candidate for various applications in medicinal chemistry or as an intermediate in organic synthesis. Overall, the unique combination of functional groups in this compound suggests a diverse range of chemical behavior and potential utility in various chemical contexts.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1/C10H12N2O/c1-13-10-6-3-2-5-9(10)12-8-4-7-11/h2-3,5-6,12H,4,8H2,1H3

SMILES: COc1ccccc1NCCC#N

Synonyms:

• 3-(2-Methoxy-phenylamino)-propionitrile
• Propanenitrile, 3-[(2-Methoxyphenyl)Amino]-

3-[(2-Methoxyphenyl)amino]propanenitrile

CAS: 27472-15-7

Versatile small molecule scaffold

Formula: C₁₀H₁₂N₂O

Purity: Min. 95%

Molecular weight: 176.21 g/mol

Ref: 3D-CBA47215