CAS 27473-62-7
:2-amino-2,3-dihydro-1H-indene-2-carboxylic acid
Description:
2-Amino-2,3-dihydro-1H-indene-2-carboxylic acid, with the CAS number 27473-62-7, is an organic compound characterized by its bicyclic structure, which includes an indene moiety. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as an amino acid derivative. It is typically a white to off-white solid, soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The compound may exhibit both acidic and basic properties, allowing it to participate in various chemical reactions, including peptide synthesis and other transformations relevant in organic chemistry and medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds that interact with biological systems. Additionally, the presence of the indene structure may impart unique electronic and steric properties, making it a subject of interest in material science and organic synthesis.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c11-10(9(12)13)5-7-3-1-2-4-8(7)6-10/h1-4H,5-6,11H2,(H,12,13)
SMILES:c1ccc2CC(Cc2c1)(C(=O)O)N
Synonyms:- 1H-indene-2-carboxylic acid, 2-amino-2,3-dihydro-
- 2-Amino-2-indancarboxylicacid
- 2-Aminoindane-2-carboxylic acid
- 2-Amino-2-Indancarboxylic acid
- 2-Aminoindan-2-carboxylic acid, tech. (96 % 1H-NMR)
- 2-Amino-2-carboxyindan.
- AKOS 258
- 2-AMINOINDAN-2-CARBOXYLIC ACID
- NSC 70943
- H-AIC-OH
- 2-amino-1,3-dihydroindene-2-carboxylic acid
- 2-Aminoindane-2-carboxylic acid≥ 99% (HPLC)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-2-indancarboxylic acid
CAS:Formula:C10H11NO2Purity:97%Color and Shape:SolidMolecular weight:177.19982-Aminoindane-2-carboxylic acid
CAS:2-Aminoindane-2-carboxylic acidFormula:C10H11NO2Purity:≥95%Molecular weight:177.199842-Aminoindane-2-carboxylic acid
CAS:2-Aminoindane-2-carboxylic acid is a potent opioid analgesic with a high affinity for kappa-opioid receptors. Molecular modeling studies suggest that it binds to the receptor in an orientation similar to morphine and has a higher binding affinity than morphine. In functional assays, 2-Aminoindane-2-carboxylic acid showed low potency at the delta opioid receptor. It also has been shown to have a high affinity for the kappa opioid receptor and a low affinity for delta opioid receptors, which are associated with respiratory depression. This drug can be made from indole and carboxylic acids or by treating 2 aminoindanone with hydrochloric acid and hydrogen gas.Formula:C10H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:177.2 g/mol2-Aminoindane-2-carboxylic acid
CAS:Formula:C10H11NO2Purity:97%Color and Shape:Solid, White powderMolecular weight:177.2032-Aminoindan-2-carboxylic Acid
CAS:Controlled ProductApplications 2-Aminoindan-2-carboxylic Acid can be used as a potential tyrosine hydroxylase inhibitor.
References Pinder, R., et al.: J. Med. Chem., 14, 892 (1971)Formula:C10H11NO2Color and Shape:NeatMolecular weight:177.2




