CAS 27478-34-8
:Dinitronaphthalene
Description:
Dinitronaphthalene, with the CAS number 27478-34-8, is an aromatic compound characterized by the presence of two nitro groups (-NO2) attached to a naphthalene ring. This compound typically exists as a yellow crystalline solid and is known for its relatively high stability and low solubility in water, but it is soluble in organic solvents such as ethanol and acetone. Dinitronaphthalene is primarily used in the synthesis of dyes, pigments, and other chemical intermediates. It exhibits significant reactivity due to the presence of the nitro groups, which can participate in electrophilic substitution reactions. Additionally, it is important to note that dinitronaphthalene can be hazardous, as it may pose environmental and health risks, including potential carcinogenic effects. Proper handling and safety measures are essential when working with this compound in laboratory or industrial settings. Overall, dinitronaphthalene is a notable compound in organic chemistry with various applications, particularly in the dye industry.
Formula:C10H6N2O4
InChI:InChI=1/C10H6N2O4/c13-11(14)9-6-5-7-3-1-2-4-8(7)10(9)12(15)16/h1-6H
SMILES:c1ccc2c(c1)ccc(c2N(=O)=O)N(=O)=O
Synonyms:- 248-484-4
- Dinitronaphthalene
- Naphthalene, dinitro-
- 1,2-Dinitronaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
