CAS 27483-92-7: 2-(chloromethyl)-1-methylpiperidine hydrochloride (1:1)

Description:2-(Chloromethyl)-1-methylpiperidine hydrochloride is a chemical compound characterized by its piperidine structure, which includes a six-membered ring containing one nitrogen atom. This compound features a chloromethyl group attached to the second carbon of the piperidine ring, contributing to its reactivity and potential applications in organic synthesis. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various chemical reactions and biological studies. Typically, compounds like this are used in medicinal chemistry and may serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for interactions with biological systems, which can be explored for therapeutic effects. Safety data sheets would indicate handling precautions due to the presence of the chloromethyl group, which can be reactive. As with many chemical substances, proper storage and handling are essential to ensure stability and minimize risks associated with exposure.

Formula:C₇H₁₅Cl₂N

InChI:InChI=1/C7H14ClN.ClH/c1-9-5-3-2-4-7(9)6-8;/h7H,2-6H2,1H3;1H

Found 4 products.

Product data	Purity	Price range	Estimated delivery
N-(2-Chloromethyl)-N-methylpiperidine, hydrochloride salt REF: IN-DA00BD7KCAS: 27483-92-7	95%	To inquire	Tue 12 Aug 25
2-Chloromethyl-1-methylpiperidine hydrochloride REF: 54-OR11727CAS: 27483-92-7	95	53.00 €~288.00 €	Wed 13 Aug 25
2-(Chloromethyl)-1-methylpiperidine hydrochloride REF: 10-F067857CAS: 27483-92-7	97.0%	63.00 €~875.00 €	Mon 18 Aug 25
2-(Chloromethyl)-1-methylpiperidine hydrochloride REF: 3D-FC120581CAS: 27483-92-7	Min. 95%	- - -	Discontinued product