CAS 27487-83-8
:α-(3-Chloropropyl)-3,4-dimethoxy-α-(1-methylethyl)benzeneacetonitrile
Description:
α-(3-Chloropropyl)-3,4-dimethoxy-α-(1-methylethyl)benzeneacetonitrile, with the CAS number 27487-83-8, is a chemical compound that belongs to the class of substituted benzene derivatives. This compound features a benzene ring substituted with methoxy groups, a chloropropyl chain, and an acetonitrile functional group, which contributes to its unique chemical properties. The presence of the chloropropyl group introduces a halogen, which can influence the compound's reactivity and potential interactions in various chemical environments. The methoxy groups enhance the compound's solubility in organic solvents and may also affect its electronic properties, making it a candidate for various applications in organic synthesis and medicinal chemistry. Additionally, the acetonitrile moiety can impart polar characteristics, influencing the compound's behavior in different solvents. Overall, this compound's structural features suggest potential utility in research and development, particularly in the fields of pharmaceuticals and agrochemicals. However, specific safety and handling guidelines should be followed due to the presence of chlorine and other reactive groups.
Formula:C16H22ClNO2
InChI:InChI=1S/C16H22ClNO2/c1-12(2)16(11-18,8-5-9-17)13-6-7-14(19-3)15(10-13)20-4/h6-7,10,12H,5,8-9H2,1-4H3
InChI key:InChIKey=VDQLTWSIHIWIFQ-UHFFFAOYSA-N
SMILES:C(CCCCl)(C(C)C)(C#N)C1=CC(OC)=C(OC)C=C1
Synonyms:- 5-Chloro-2-(3,4-Dimethoxyphenyl)-2-(Propan-2-Yl)Pentanenitrile
- Benzeneacetonitrile, α-(3-chloropropyl)-3,4-dimethoxy-α-(1-methylethyl)-
- Valeronitrile, 5-chloro-2-(3,4-dimethoxyphenyl)-2-isopropyl-
- α-(3-Chloropropyl)-3,4-dimethoxy-α-(1-methylethyl)benzeneacetonitrile
- 5-Chloro-2-(3,4-dimethoxyphenyl)-2-isopropylvaleronitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Chloro-2-(3,4-dimethoxyphenyl)-2-isopropylvaleronitrile
CAS:Controlled Product<p>Applications Intermediate for synthesis of verapamil and analogs.<br></p>Formula:C16H22ClNO2Color and Shape:NeatMolecular weight:295.80
