CAS 27489-60-7: N-(trans-4-Hydroxycyclohexyl)acetamide
Description:N-(trans-4-Hydroxycyclohexyl)acetamide, with the CAS number 27489-60-7, is an organic compound characterized by its amide functional group, which is derived from acetic acid and a cyclohexanol derivative. This substance features a cyclohexane ring with a hydroxyl group positioned at the trans-4 position, contributing to its unique stereochemistry and potential for hydrogen bonding. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl and amide groups. The compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug formulation and as a building block in organic synthesis. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups in a formulation. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h7-8,11H,2-5H2,1H3,(H,9,10)/t7-,8-
InChI key:InChIKey=HWAFCRWGGRVEQL-ZKCHVHJHNA-N
SMILES:O=C(NC1CCC(O)CC1)C
- Synonyms:
- Acetamide, N-(4-hydroxycyclohexyl)-, trans-
- Acetamide, N-(trans-4-hydroxycyclohexyl)-
- N-(trans-4-Hydroxycyclohexyl)acetamide
- trans-4-Acetamidocyclohexanol
- trans-N-(4-Hydroxycyclohexyl)acetamide
- trans-N-Acetyl-4-hydroxycyclohexylamine
