CAS 27490-33-1
:1-(Tributylstannyl)methanol
Description:
1-(Tributylstannyl)methanol, with the CAS number 27490-33-1, is an organotin compound characterized by the presence of a tributyltin group attached to a methanol moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively high molecular weight due to the bulky tributyl groups. It exhibits properties typical of organotin compounds, including potential applications in organic synthesis and as a reagent in various chemical reactions. The presence of the tin atom contributes to its reactivity, particularly in nucleophilic substitution reactions. Additionally, 1-(Tributylstannyl)methanol may exhibit some degree of toxicity, a common concern with organotin compounds, necessitating careful handling and disposal. Its solubility in organic solvents makes it useful in various chemical processes, while its stability under certain conditions allows for its use in synthetic applications. As with many organotin compounds, environmental and health regulations may apply due to their potential bioaccumulation and toxicity.
Formula:C13H30OSn
InChI:InChI=1S/3C4H9.CH3O.Sn/c3*1-3-4-2;1-2;/h3*1,3-4H2,2H3;2H,1H2;
InChI key:InChIKey=MKBQBFPNTLPOIV-UHFFFAOYSA-N
SMILES:[Sn](CCCC)(CCCC)(CCCC)CO
Synonyms:- Methanol, (tributylstannyl)-
- Tributyl(hydroxymethyl)stannane
- (Tributylstannyl)methanol
- 1-(Tributylstannyl)methanol
- Methanol, 1-(tributylstannyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Tributylstannyl)methanol
CAS:Controlled ProductFormula:C4H9·CH3O·SnColor and Shape:NeatMolecular weight:321.087(Tributylstannyl)methanol
CAS:Controlled Product(Tributylstannyl)methanol is a chemical that has been used in organic synthesis as a chromophore. It is also a powerful oxidant and can be used to make benzofuran derivatives. (Tributylstannyl)methanol is also an effective restenosis inhibitor, which may be due to its ability to inhibit the inflammatory response. (Tributylstannyl)methanol is a chromatographic method for the detection of chloride ion, which can be used in the treatment of bacterial infections. The use of this compound has been shown to have some success in the treatment of carbapenem-resistant Enterobacteriaceae isolates and other bacterial strains such as Mycobacterium tuberculosis, Mycobacterium avium complex, Pseudomonas aeruginosa, and Acinetobacter baumannii.Formula:C13H30OSnPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:321.09 g/molMethanol, (tributylstannyl)-
CAS:Formula:C13H30OSnPurity:95%Color and Shape:LiquidMolecular weight:321.0777Ref: IN-DA00C33W
Discontinued product




