CAS 27493-61-4
:val-ala
Description:
Val-Ala, or Valine-Alanine, is a dipeptide composed of the amino acids valine and alanine. It is characterized by its structure, which consists of a peptide bond linking the carboxyl group of valine to the amino group of alanine. This compound is classified as a non-polar, hydrophobic dipeptide due to the presence of the aliphatic side chains of both amino acids. Val-Ala is often studied in the context of protein synthesis and metabolism, as well as its potential roles in various biological processes. It may also exhibit specific biological activities, such as influencing muscle metabolism and protein synthesis. The CAS number 27493-61-4 uniquely identifies this compound in chemical databases, facilitating its study and application in research. Val-Ala can be synthesized through peptide coupling reactions and is of interest in fields such as biochemistry, nutrition, and pharmacology. Its properties, including solubility and stability, can vary depending on environmental conditions such as pH and temperature.
Formula:C8H16N2O3
InChI:InChI=1/C8H16N2O3/c1-4(2)6(9)7(11)10-5(3)8(12)13/h4-6H,9H2,1-3H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1
SMILES:CC(C)[C@@H](C(=N[C@@H](C)C(=O)O)O)N
Synonyms:- H-Val-Ala-OH
- L-Valyl-L-alanine
- (2S)-2-{[(2S)-2-ammonio-3-methylbutanoyl]amino}propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(S)-2-((S)-2-Amino-3-Methylbutanamido)Propanoic Acid
CAS:(S)-2-((S)-2-Amino-3-Methylbutanamido)Propanoic AcidPurity:97%Molecular weight:188.22g/molL-Valyl-L-alanine
CAS:Formula:C8H16N2O3Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:188.23H-Val-Ala-OH
CAS:H-Val-Ala-OH, a metabolite, is a dipeptide of L-Valine and L-Alanine.Formula:C8H16N2O3Purity:99.49%Color and Shape:SolidMolecular weight:188.22(S)-2-((S)-2-Amino-3-methylbutanamido)propanoic acid
CAS:Formula:C8H16N2O3Purity:95%Color and Shape:SolidMolecular weight:188.227H-Val-Ala-OH
CAS:A hydrophobic nanotube-forming dipeptide. The pores absorb and store gases as methane or hydrogen.Formula:C8H16N2O3Purity:> 99%Color and Shape:White PowderMolecular weight:188.23






