CAS 27508-85-6
:5,7-dimethoxy-1H-indole
Description:
5,7-Dimethoxy-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two methoxy groups at the 5 and 7 positions of the indole ring significantly influences its chemical properties and reactivity. This compound is typically a white to off-white solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but may have limited solubility in water. It is often studied for its potential biological activities, including its role in medicinal chemistry and as a precursor in the synthesis of various pharmaceuticals. The methoxy substituents can enhance the compound's lipophilicity, potentially affecting its interaction with biological targets. Additionally, 5,7-dimethoxy-1H-indole may exhibit fluorescence properties, making it useful in certain analytical applications. As with many indole derivatives, it may also participate in various chemical reactions, including electrophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c1-12-8-5-7-3-4-11-10(7)9(6-8)13-2/h3-6,11H,1-2H3
SMILES:COc1cc2cc[nH]c2c(c1)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5,7-Dimethoxyindole
CAS:<p>5,7-Dimethoxyindole is a potent inhibitor of the enzyme oxidase. 5,7-Dimethoxyindole has been shown to inhibit the growth of a number of fungi, including Phytophthora infestans and Cryptococcus neoformans. The molecular modeling studies have shown that this molecule can form an H-bond with the acceptor in the active site of the enzyme and prevent access by substrate. This inhibition has been shown to be competitive with respect to ferrous ions and noncompetitive with respect to other cofactors. 5,7-Dimethoxyindole also inhibits integrase enzymes, which are involved in DNA integration during viral replication. 5,7-Dimethoxyindole was found to bind to a pharmacophore model for integrase inhibitors and formylation reactions. This compound is also magnetic due to its high electron density at the methoxy group.</p>Formula:C10H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:177.2 g/mol
