CAS 2753-30-2: Gedunin
Description:Gedunin is a naturally occurring chemical compound classified as a limonoid, primarily derived from the seeds of the neem tree (Azadirachta indica). It is known for its diverse biological activities, including antimalarial, antifungal, and anticancer properties. Gedunin exhibits a complex molecular structure characterized by multiple rings and functional groups, which contribute to its pharmacological effects. The compound has garnered interest in medicinal chemistry due to its potential therapeutic applications, particularly in the development of new antimalarial agents. Additionally, gedunin's mechanism of action involves the inhibition of certain enzymes and pathways critical for the survival of pathogens, making it a subject of research in the field of drug discovery. Its solubility and stability in various solvents can vary, influencing its bioavailability and efficacy. Overall, gedunin represents a significant area of study for researchers exploring natural products as sources of novel therapeutic compounds.
Formula:C28H34O7
InChI:InChI=1S/C28H34O7/c1-15(29)33-20-13-18-24(2,3)19(30)8-10-25(18,4)17-7-11-26(5)21(16-9-12-32-14-16)34-23(31)22-28(26,35-22)27(17,20)6/h8-10,12,14,17-18,20-22H,7,11,13H2,1-6H3/t17-,18+,20-,21+,22-,25-,26+,27+,28-/m1/s1
InChI key:InChIKey=YJXDGWUNRYLINJ-BHAPSIHVSA-N
SMILES:O=C(OC1CC2C(C=CC(=O)C2(C)C)(C)C3CCC4(C)C(OC(=O)C5OC54C13C)C6=COC=C6)C
- Synonyms:
- Gedunin
- 16,17-Seco-24-nor-5α,13α,14β,17α-chola-1,20,22-trien-16-oic acid, 14,15β:21,23-diepoxy-7α,17-dihydroxy-4,4,8-trimethyl-3-oxo-, 16,17-lactone, acetate
- Oxireno[c]phenanthro[1,2-d]pyran-3,8(3aH,4bH)-dione, 5-(acetyloxy)-1-(3-furanyl)-1,5,6,6a,7,10a,10b,11,12,12a-decahydro-4b,7,7,10a,12a-pentamethyl-, (1S,3aS,4aR,4bS,5R,6aR,10aR,10bR,12aS)-
- D-Homo-24-nor-17-oxachola-1,20,22-triene-3,16-dione, 7-(acetyloxy)-14,15:21,23-diepoxy-4,4,8-trimethyl-, (5α,7α,13α,14β,15β,17aα)-
- (1S,3aS,4aR,4bS,5R,6aR,10aR,10bR,12aS)-5-(Acetyloxy)-1-(3-furanyl)-1,5,6,6a,7,10a,10b,11,12,12a-decahydro-4b,7,7,10a,12a-pentamethyloxireno[c]phenanthro[1,2-d]pyran-3,8(3aH,4bH)-dione
