CymitQuimica logo

CAS 27537-87-7

:

3-Amino-6-chloro-3,4-dihydro-2-methyl-4-phenyl-4-quinazolinol

Description:
3-Amino-6-chloro-3,4-dihydro-2-methyl-4-phenyl-4-quinazolinol is a chemical compound characterized by its quinazolinol structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. This compound typically exhibits a range of functional groups, including an amino group and a chloro substituent, which can influence its reactivity and biological activity. The presence of the phenyl group contributes to its hydrophobic character, while the amino and chloro groups can participate in hydrogen bonding and other intermolecular interactions. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the pH and solvent conditions. Additionally, the specific stereochemistry and substituent positions can significantly affect its biological activity and potential applications in drug development. As with many quinazolinol derivatives, it may be investigated for its potential therapeutic effects, including anti-inflammatory or anticancer properties.
Formula:C15H14ClN3O
InChI:InChI=1S/C15H14ClN3O/c1-10-18-14-8-7-12(16)9-13(14)15(20,19(10)17)11-5-3-2-4-6-11/h2-9,20H,17H2,1H3
InChI key:InChIKey=IEQYCNKKNGEMAN-UHFFFAOYSA-N
SMILES:OC1(C=2C(N=C(C)N1N)=CC=C(Cl)C2)C3=CC=CC=C3
Synonyms:
  • 3-Amino-6-chloro-3,4-dihydro-2-methyl-4-phenyl-4-quinazolinol
  • 3-Amino-6-chloro-3,4-dihydro-4-hydroxy-2-methyl-4-phenylquinazoline
  • 3-Amino-6-chloro-2-methyl-4-phenylquinazolin-4-ol
  • 4-Quinazolinol, 3-amino-6-chloro-3,4-dihydro-2-methyl-4-phenyl-
  • 3-Amino-6-chloro-2-methyl-4-phenyl-3,4-dihydroquinazolin-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.