CAS 27542-37-6

(+)-Volkensiflavone

Description:

(+)-Volkensiflavone is a naturally occurring flavonoid compound classified as a biflavonoid, which consists of two flavonoid units linked together. It is primarily found in certain plant species, particularly in the genus *Ginkgo*. This compound exhibits a range of biological activities, including antioxidant properties, which contribute to its potential health benefits. The structure of (+)-Volkensiflavone features a complex arrangement of aromatic rings and hydroxyl groups, which are characteristic of flavonoids, allowing for various interactions with biological molecules. Its stereochemistry, indicated by the (+) designation, suggests that it has a specific spatial arrangement that may influence its biological activity and interaction with receptors. Research into (+)-Volkensiflavone has indicated potential applications in pharmacology, particularly in the areas of anti-inflammatory and neuroprotective effects. However, further studies are needed to fully elucidate its mechanisms of action and therapeutic potential. As with many natural compounds, the extraction and purification processes can affect its availability and efficacy in research and potential applications.

Formula: C₃₀H₂₀O₁₀

InChI: InChI=1S/C30H20O10/c31-15-5-1-13(2-6-15)22-12-21(37)24-19(35)11-20(36)26(30(24)39-22)27-28(38)25-18(34)9-17(33)10-23(25)40-29(27)14-3-7-16(32)8-4-14/h1-12,27,29,31-36H/t27-,29+/m1/s1

InChI key: InChIKey=YOGANETYFUQWIM-PXJZQJOASA-N

SMILES: O=C1[C@H]([C@@H](OC=2C1=C(O)C=C(O)C2)C3=CC=C(O)C=C3)C4=C5C(C(=O)C=C(O5)C6=CC=C(O)C=C6)=C(O)C=C4O

Synonyms:

• (2R,3S)-2,3-Dihydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)[3,8′-bi-4H-1-benzopyran]-4,4′-dione
• Volkensiflavone
• Talbotaflavone
• Flavanone, 3-[5,7-dihydroxy-2-(p-hydroxyphenyl)-4-oxo-4H-1-benzopyran-8-yl]-4′,5,7-trihydroxy-
• [3,8′-Bi-4H-1-benzopyran]-4,4′-dione, 2,3-dihydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, (2R,3S)-

[3,8'-Bi-4H-1-benzopyran]-4,4'-dione, 2,3-dihydro-5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-, (2R,3S)-

CAS: 27542-37-6

Formula: C₃₀H₂₀O₁₀

Molecular weight: 540.4738

Ref: IN-DA002U1S

Volkensiflavone

CAS: 27542-37-6

Volkensiflavone, a biflavonoid in astragalus and garcinia, aids against antibiotic-resistant Staphylococcus aureus.

Formula: C₃₀H₂₀O₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 540.47

Ref: TM-TN5530

Volkensiflavone

CAS: 27542-37-6

Volkensiflavone is a biflavonoid compound, which is derived primarily from various natural plant sources such as Selaginella species. Its molecular structure consists of two flavonoid units, which contribute to its unique biological activities. The mode of action of volkensiflavone involves modulation of multiple cellular pathways, including antioxidant, anti-inflammatory, and enzyme inhibition activities. It demonstrates potential by interacting with specific proteins and receptors, influencing cellular responses and signaling.

Formula: C₃₀H₂₀O₁₀

Purity: Min. 95%

Molecular weight: 540.5 g/mol

Ref: 3D-CBA54237