CAS 27544-18-9

S(-)-1-(2-naphthyl)ethanol

Description:

S(-)-1-(2-naphthyl)ethanol, with the CAS number 27544-18-9, is an organic compound characterized by its chiral structure, featuring a naphthyl group attached to a secondary alcohol. This compound is known for its optical activity, as it exists in two enantiomeric forms, with the S(-) configuration being the specific enantiomer of interest. It typically appears as a colorless to pale yellow liquid and has a relatively low volatility. The presence of the naphthyl group contributes to its hydrophobic characteristics, while the hydroxyl (-OH) group imparts some degree of polarity, allowing for potential hydrogen bonding. S(-)-1-(2-naphthyl)ethanol is often utilized in asymmetric synthesis and as a chiral auxiliary in various chemical reactions, particularly in the pharmaceutical industry. Its unique properties make it valuable in the development of enantiomerically pure compounds, which are crucial for the efficacy and safety of many drugs. Additionally, its behavior in different solvents and under various conditions can provide insights into stereochemistry and molecular interactions.

Formula: C₁₂H₁₂O

InChI: InChI=1/C12H12O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h2-9,13H,1H3/t9-/m0/s1

SMILES: C[C@@H](c1ccc2ccccc2c1)O

Synonyms:

• (S)-(-)-alpha-methyl-2-naphthalene-methanol
• (S)-()-alphaMethyl-2-naphthalenemethanol
• (1S)-1-(2-naphthyl)ethanol

(S)-1-(Naphthalen-2-yl)ethanol

CAS: 27544-18-9

Formula: C₁₂H₁₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 172.2231

Ref: IN-DA003CE2

(S)-(-)-α-Methyl-2-naphthalenemethanol

CAS: 27544-18-9

Formula: C₁₂H₁₂O

Purity: ≥ 98.0%

Color and Shape: White to off-white powder or crystals

Molecular weight: 172.22

Ref: 7W-GL0423

(S)-1-(Naphthalen-2-Yl)Ethanol

CAS: 27544-18-9

(S)-1-(Naphthalen-2-Yl)Ethanol

Purity: 98%

Molecular weight: 172.22g/mol

Ref: 54-OR1008602

(S)-(-)-1-(2-NAPHTHYL)ETHANOL

CAS: 27544-18-9

Purity: 97%

Color and Shape: Solid

Molecular weight: 172.227005

Ref: 10-F852150

(S)-(-)-1-(2-Naphthyl)ethanol

Controlled Product

CAS: 27544-18-9

Applications (S)-(-)-1-(2-Naphthyl)ethanol is a useful biochemical for proteomics research.

Formula: C₁₂H₁₂O

Color and Shape: Neat

Molecular weight: 172.223

Ref: TR-N378363