CAS 27552-97-2
:cytidylyl-(3'-5')uridine ammonium
Description:
Cytidylyl-(3'-5')uridine ammonium, also known as cytidine 3',5'-uridine or simply cytidylyl-uridine, is a nucleotide derivative that plays a significant role in various biochemical processes. It is composed of a cytidine base linked to a uridine base through a phosphodiester bond, specifically in the 3'-5' orientation. This compound is often involved in cellular signaling and can act as a precursor in the synthesis of RNA. Its ammonium form indicates the presence of an ammonium ion, which can influence its solubility and interaction with biological molecules. The substance is typically soluble in water, making it suitable for various laboratory applications, including studies in molecular biology and biochemistry. Additionally, it may exhibit biological activity, potentially influencing cellular processes such as gene expression and metabolism. As with many nucleotides, its stability and reactivity can be affected by environmental conditions, such as pH and temperature, which are important considerations in experimental settings.
Formula:C18H27N6O13P
InChI:InChI=1/C18H24N5O13P.H3N/c19-9-1-3-22(17(29)20-9)16-13(28)14(7(5-24)34-16)36-37(31,32)33-6-8-11(26)12(27)15(35-8)23-4-2-10(25)21-18(23)30;/h1-4,7-8,11-16,24,26-28H,5-6H2,(H,31,32)(H2,19,20,29)(H,21,25,30);1H3
SMILES:c1cn(C2C(C(C(CO)O2)OP(=O)(O)OCC2C(C(C(n3ccc(nc3=O)O)O2)O)O)O)c(nc1=N)O.N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cytidyl-3'-5'-uridine ammonium
CAS:<p>Cytidyl-3'-5'-uridine ammonium salt is a nucleoside analog that is used as an antiviral and anticancer agent. Cytidyl-3'-5'-uridine ammonium salt inhibits the synthesis of DNA by inhibiting the activity of enzymes such as DNA polymerase, RNA polymerase, or reverse transcriptase. It also has antitumor properties and can be used to treat leukemia and other types of cancer. Cytidyl-3'-5'-uridine ammonium salt has been shown to be more potent than cytidyl-2',4',6'-triaminopyrimidine (CTAP) in inhibiting the growth of lymphocytic leukemia cells.</p>Formula:C18H24N5O13P•NH3Purity:Min. 95%Color and Shape:PowderMolecular weight:566.42 g/mol
