CAS 27579-97-1
:(3aS,5aR,9bR)-3a,4,5,5a,6,7,8,9b-Octahydro-5a,9-dimethyl-3-methylenenaphtho[1,2-b]furan-2(3H)-one
Description:
The chemical substance with the name "(3aS,5aR,9bR)-3a,4,5,5a,6,7,8,9b-Octahydro-5a,9-dimethyl-3-methylenenaphtho[1,2-b]furan-2(3H)-one" and CAS number 27579-97-1 is a complex organic compound characterized by its polycyclic structure, which includes a fused naphthalene and furan moiety. This compound features multiple stereocenters, contributing to its specific three-dimensional configuration, which can influence its chemical reactivity and biological activity. The presence of the methylene and dimethyl groups suggests potential sites for further chemical modification or interaction. Its octahydro structure indicates that it is fully saturated, which typically enhances stability and solubility in organic solvents. Such compounds may exhibit interesting properties, including potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, detailed studies would be necessary to fully elucidate its reactivity, biological activity, and potential uses in various fields.
Formula:C15H20O2
InChI:InChI=1S/C15H20O2/c1-9-5-4-7-15(3)8-6-11-10(2)14(16)17-13(11)12(9)15/h11,13H,2,4-8H2,1,3H3/t11-,13+,15+/m0/s1
InChI key:InChIKey=PJPHIAMRKUNVSU-NJZAAPMLSA-N
SMILES:C[C@]12C([C@]3([C@@](CC1)(C(=C)C(=O)O3)[H])[H])=C(C)CCC2
Synonyms:- Naphtho[1,2-b]furan-2(3H)-one, 3a,4,5,5a,6,7,8,9b-octahydro-5a,9-dimethyl-3-methylene-, (3aS,5aR,9bR)-
- (3aS,5aR,9bR)-3a,4,5,5a,6,7,8,9b-Octahydro-5a,9-dimethyl-3-methylenenaphtho[1,2-b]furan-2(3H)-one
- Eudesma-4,11(13)-dien-12-oic acid, 6β-hydroxy-, γ-lactone
- Frullanolide, (-)-
- Naphtho[1,2-b]furan-2(3H)-one, 3a,4,5,5a,6,7,8,9b-octahydro-5a,9-dimethyl-3-methylene-, [3aS-(3aα,5aβ,9bα)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
