CymitQuimica logo

CAS 2758-98-7

:

2-Piperazinecarboxylic acid methyl ester

Description:
2-Piperazinecarboxylic acid methyl ester, with the CAS number 2758-98-7, is an organic compound characterized by its piperazine ring structure, which is a six-membered cyclic amine. This compound features a carboxylic acid group that is esterified with a methyl group, contributing to its solubility in organic solvents. It typically appears as a white to off-white crystalline solid or a viscous liquid, depending on the specific conditions. The presence of the piperazine moiety imparts basic properties, allowing it to interact with various biological systems, making it of interest in pharmaceutical applications. Its chemical formula reflects the presence of nitrogen atoms, which can participate in hydrogen bonding, influencing its reactivity and interactions. Additionally, 2-Piperazinecarboxylic acid methyl ester can serve as a precursor or intermediate in the synthesis of more complex molecules, particularly in the development of drugs and agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C6H12N2O2
InChI:InChI=1/C6H12N2O2/c1-10-6(9)5-4-7-2-3-8-5/h5,7-8H,2-4H2,1H3
SMILES:COC(=O)C1CNCCN1
Synonyms:
  • Methyl Piperazine-2-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.