CAS 27582-20-3

7-methyl-7aH-imidazo[4,5-b]pyridine

Description:

7-Methyl-7aH-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings. This compound features a methyl group at the 7-position of the imidazole ring, which contributes to its unique chemical properties. It is typically a pale yellow to brown solid, and its structure includes nitrogen atoms that can participate in various chemical reactions, making it of interest in medicinal chemistry and organic synthesis. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and biologically active compounds. Additionally, the compound may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its CAS number, 27582-20-3, allows for easy identification in chemical databases and literature. Overall, 7-methyl-7aH-imidazo[4,5-b]pyridine is a compound of interest due to its structural features and potential applications in various fields of chemistry.

Formula: C₇H₇N₃

InChI: InChI=1/C7H7N3/c1-5-2-3-8-7-6(5)9-4-10-7/h2-4,6H,1H3

SMILES: CC1=CC=NC2=NC=NC12

Synonyms:

• 7-methyl-3H-imidazo[4,5-b]pyridine

3H-Imidazo[4,5-b]pyridine, 7-methyl-

CAS: 27582-20-3

Formula: C₇H₇N₃

Purity: 97%

Molecular weight: 133.1506

Ref: IN-DA002U50

7-Methyl-3H-imidazo[4,5-b]pyridine

CAS: 27582-20-3

7-Methyl-3H-imidazo[4,5-b]pyridine

Purity: 95%

Molecular weight: 133.15g/mol

Ref: 54-OR952650

7-METHYL-3H-IMIDAZO[4,5-B]PYRIDINE

CAS: 27582-20-3

Formula: C₇H₇N₃

Purity: 98%

Molecular weight: 133.154

Ref: 10-F301582

7-Methyl-1H-imidazo[4,5-b]pyridine

CAS: 27582-20-3

7-Methyl-1H-imidazo[4,5-b]pyridine is an optimised molecule for the treatment of various cancers. It has a hydrophobic nature and can be used to prevent the spread of cancer cells through the body by blocking their ability to attach to other cells. The 7-Methyl-1H-imidazo[4,5-b]pyridine molecule is composed of a pyridine ring with a hydrogen atom at the 4th position and is capable of forming hydrogen bonding interactions with complementary molecules. This chemical also blocks DNA polymerase enzymes that are responsible for copying genetic information from DNA to RNA, which prevents cell division.

Formula: C₇H₇N₃

Purity: Min. 95%

Molecular weight: 133.15 g/mol

Ref: 3D-CBA58220