CymitQuimica logo

CAS 27586-72-7

:

1-cyclohexylethanamine hydrochloride (1:1)

Description:
1-Cyclohexylethanamine hydrochloride (1:1) is an organic compound characterized by its amine functional group, which contributes to its basicity and potential for forming salts. The presence of a cyclohexyl group provides hydrophobic characteristics, influencing its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as moderate to high melting points and stability under standard conditions, although specific thermal and solubility characteristics can vary. Its structure suggests potential applications in medicinal chemistry, particularly in the development of psychoactive substances or as intermediates in organic synthesis. Safety and handling precautions are essential, as with many amines, due to potential irritant effects and toxicity. Overall, 1-cyclohexylethanamine hydrochloride serves as a valuable compound in both research and industrial contexts, warranting further investigation into its biological activity and potential therapeutic uses.
Formula:C8H18ClN
InChI:InChI=1/C8H17N.ClH/c1-7(9)8-5-3-2-4-6-8;/h7-8H,2-6,9H2,1H3;1H
InChI key:SESCRFJUMZOXDM-UHFFFAOYSA-N
SMILES:CC(C1CCCCC1)N.Cl
Found 5 products.