CAS 27586-77-2
:cyclopentyl-(2,5-dimethylphenyl)methanone
Description:
Cyclopentyl-(2,5-dimethylphenyl)methanone, identified by its CAS number 27586-77-2, is an organic compound characterized by its ketone functional group and a unique structure that includes a cyclopentyl group and a 2,5-dimethylphenyl moiety. This compound typically exhibits a relatively low melting point and boiling point, indicative of its organic nature and the presence of non-polar groups. It is likely to be a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the cyclopentyl ring contributes to its cyclic structure, which can influence its reactivity and interactions with other molecules. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and oxidation processes. Additionally, its aromatic component suggests potential for pi-stacking interactions, which can affect its solubility and behavior in different solvents. Overall, cyclopentyl-(2,5-dimethylphenyl)methanone is a compound of interest in organic synthesis and may have applications in pharmaceuticals or materials science.
Formula:C14H18O
InChI:InChI=1/C14H18O/c1-10-7-8-11(2)13(9-10)14(15)12-5-3-4-6-12/h7-9,12H,3-6H2,1-2H3
SMILES:Cc1ccc(C)c(c1)C(=O)C1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
