CAS 27597-77-9

β-D-Glucopyranoside, 4-[[4-(dimethylamino)phenyl]azo]phenyl 4-O-β-D-galactopyranosyl-

Description:

β-D-Glucopyranoside, 4-[[4-(dimethylamino)phenyl]azo]phenyl 4-O-β-D-galactopyranosyl- is a complex organic compound characterized by its glycosidic structure, which includes a glucopyranoside moiety and a galactopyranosyl group. The presence of the azo group, derived from the coupling of an amine with a diazonium salt, imparts distinct chromophoric properties, making it useful in dye applications. This compound typically exhibits solubility in polar solvents due to its sugar components, while the aromatic and azo functionalities contribute to its potential for colorimetric applications. Its molecular structure suggests it may participate in various chemical reactions, including those involving nucleophilic substitutions or redox processes. Additionally, the dimethylamino group can influence the compound's electronic properties, potentially enhancing its reactivity or interaction with biological systems. Overall, this compound's unique combination of sugar and aromatic functionalities makes it of interest in fields such as biochemistry, materials science, and dye chemistry.

Formula: C₂₆H₃₅N₃O₁₁

InChI: InChI=1S/C26H35N3O11/c1-29(2)15-7-3-13(4-8-15)27-28-14-5-9-16(10-6-14)37-25-23(36)21(34)24(18(12-31)39-25)40-26-22(35)20(33)19(32)17(11-30)38-26/h3-10,17-26,30-36H,11-12H2,1-2H3/t17-,18-,19+,20+,21-,22-,23-,24-,25-,26+/m1/s1

InChI key: InChIKey=PKTBUSPVTXIOCN-QHIUXXQWSA-N

SMILES: O([C@@H]1[C@@H](CO)O[C@@H](OC2=CC=C(N=NC3=CC=C(N(C)C)C=C3)C=C2)[C@H](O)[C@H]1O)[C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O

Synonyms:

• Glucopyranoside, p-[[p-(dimethylamino)phenyl]azo]phenyl 4-O-β-D-galactopyranosyl-, β-D-
• β-D-Glucopyranoside, 4-[[4-(dimethylamino)phenyl]azo]phenyl 4-O-β-D-galactopyranosyl-
• p-(p-Dimethylaminophenylazo)phenyl β-lactoside

Lac dye

CAS: 27597-77-9

Lac dye: non-toxic, water-soluble food colorant derived from Laccifer lacca insect's resin.

Formula: C₂₆H₃₅N₃O₁₁

Color and Shape: Solid

Molecular weight: 565.576

Ref: TM-T32519