
CAS 27597-77-9
:β-D-Glucopyranoside, 4-[[4-(dimethylamino)phenyl]azo]phenyl 4-O-β-D-galactopyranosyl-
Description:
β-D-Glucopyranoside, 4-[[4-(dimethylamino)phenyl]azo]phenyl 4-O-β-D-galactopyranosyl- is a complex organic compound characterized by its glycosidic structure, which includes a glucopyranoside moiety and a galactopyranosyl group. The presence of the azo group, derived from the coupling of an amine with a diazonium salt, imparts distinct chromophoric properties, making it useful in dye applications. This compound typically exhibits solubility in polar solvents due to its sugar components, while the aromatic and azo functionalities contribute to its potential for colorimetric applications. Its molecular structure suggests it may participate in various chemical reactions, including those involving nucleophilic substitutions or redox processes. Additionally, the dimethylamino group can influence the compound's electronic properties, potentially enhancing its reactivity or interaction with biological systems. Overall, this compound's unique combination of sugar and aromatic functionalities makes it of interest in fields such as biochemistry, materials science, and dye chemistry.
Formula:C26H35N3O11
InChI:InChI=1S/C26H35N3O11/c1-29(2)15-7-3-13(4-8-15)27-28-14-5-9-16(10-6-14)37-25-23(36)21(34)24(18(12-31)39-25)40-26-22(35)20(33)19(32)17(11-30)38-26/h3-10,17-26,30-36H,11-12H2,1-2H3/t17-,18-,19+,20+,21-,22-,23-,24-,25-,26+/m1/s1
InChI key:InChIKey=PKTBUSPVTXIOCN-QHIUXXQWSA-N
SMILES:O([C@@H]1[C@@H](CO)O[C@@H](OC2=CC=C(N=NC3=CC=C(N(C)C)C=C3)C=C2)[C@H](O)[C@H]1O)[C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O
Synonyms:- Glucopyranoside, p-[[p-(dimethylamino)phenyl]azo]phenyl 4-O-β-D-galactopyranosyl-, β-D-
- β-D-Glucopyranoside, 4-[[4-(dimethylamino)phenyl]azo]phenyl 4-O-β-D-galactopyranosyl-
- p-(p-Dimethylaminophenylazo)phenyl β-lactoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lac dye
CAS:Lac dye: non-toxic, water-soluble food colorant derived from Laccifer lacca insect's resin.Formula:C26H35N3O11Color and Shape:SolidMolecular weight:565.576
