CAS 27606-09-3
:Magnolan
Description:
Magnolan, identified by the CAS number 27606-09-3, is a chemical compound that belongs to the class of organic substances. It is primarily recognized for its applications in various industrial and research settings. Magnolan is characterized by its unique molecular structure, which contributes to its specific chemical properties, such as solubility, reactivity, and stability under different conditions. Typically, compounds like Magnolan may exhibit characteristics such as moderate to high polarity, making them suitable for interactions with other polar substances. Additionally, it may possess functional groups that influence its behavior in chemical reactions, including potential roles as a ligand or in catalysis. Safety data sheets and material safety data sheets (MSDS) should be consulted for detailed information regarding handling, toxicity, and environmental impact. Overall, Magnolan's properties make it a subject of interest in both academic research and practical applications, although specific details about its reactivity and applications would require further investigation into specialized literature.
Formula:C13H16O2
InChI:InChI=1/C13H16O2/c1-8-12-7-10-5-3-4-6-11(10)13(12)15-9(2)14-8/h3-6,8-9,12-13H,7H2,1-2H3
InChI key:InChIKey=SHWFPOIJJLMZKA-UHFFFAOYSA-N
SMILES:CC1C2C(C=3C(C2)=CC=CC3)OC(C)O1
Synonyms:- 2,4-Dimethyl-4,4A,5,9B-Tetrahydroindeno[1,2-D][1,3]Dioxine
- 2,4-Dimethyl-5,6-indeno-1,3-dioxan
- 4,4a,5,9b-Tetrahydro-2,4-dimethylindeno[1,2-d]-1,3-dioxin
- Indeno(1,2-d)-1,3-dioxin, 4,4a,5,9b-tetrahydro-2,4-dimethyl-
- Indeno[1,2-d]-m-dioxin, 4,4a,5,9b-tetrahydro-2,4-dimethyl-
- Magnolan
- 2,4-Dimethyl-4,4a,5,9b-tetrahydroindeno[1,2-d]-1,3-dioxin
- 2,4-Dimethyl-4,4a,5,9b-tetrahydroindeno(1,2-d)-1,3-dioxin
- magnolia indene
- Indeno1,2-d-1,3-dioxin, 4,4a,5,9b-tetrahydro-2,4-dimethyl-
- 4,4a,5,9b-TETRAHYDRO-2,4-DIMETHYLINDENO-(1,2d)-1,3-DIOXIN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
