
CAS 27608-01-1
:4-Methyl-2-octanone
Description:
4-Methyl-2-octanone, with the CAS number 27608-01-1, is a ketone characterized by its molecular structure, which includes a carbon chain of eight carbon atoms with a methyl group at the fourth position and a carbonyl group at the second position. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor, often described as sweet or fruity. It is soluble in organic solvents and has limited solubility in water. The substance is known for its use in various applications, including as a flavoring agent and in the synthesis of other organic compounds. Its boiling point and melting point are indicative of its volatility and stability under standard conditions. Additionally, 4-Methyl-2-octanone may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures in laboratory and industrial settings. As with many ketones, it can participate in various chemical reactions, including oxidation and reduction, making it a versatile compound in organic chemistry.
Formula:C9H18O
InChI:InChI=1S/C9H18O/c1-4-5-6-8(2)7-9(3)10/h8H,4-7H2,1-3H3
InChI key:InChIKey=YLMJOCWAOWDKBL-UHFFFAOYSA-N
SMILES:C(C(CCCC)C)C(C)=O
Synonyms:- 4-Methyl-2-octanone
- 2-Octanone, 4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
