CAS 2761-77-5
:Communic acid
Description:
Communic acid, with the CAS number 2761-77-5, is a naturally occurring organic compound classified as a fatty acid. It is primarily derived from certain plant sources and is known for its role in various biological processes. The structure of communic acid features a long hydrocarbon chain with a carboxylic acid functional group, which contributes to its properties as a surfactant and emulsifier. This compound is characterized by its relatively low solubility in water, typical of long-chain fatty acids, but it can dissolve in organic solvents. Communic acid has garnered interest in the fields of biochemistry and pharmacology due to its potential therapeutic applications, including anti-inflammatory and antimicrobial properties. Additionally, it may play a role in plant signaling and defense mechanisms. As with many fatty acids, its behavior in biological systems can be influenced by factors such as chain length and degree of saturation, which affect its interactions with cell membranes and other biomolecules.
Formula:C20H30O2
InChI:InChI=1S/C20H30O2/c1-6-14(2)8-10-16-15(3)9-11-17-19(16,4)12-7-13-20(17,5)18(21)22/h6,8,16-17H,1,3,7,9-13H2,2,4-5H3,(H,21,22)/t16-,17+,19+,20-/m0/s1
InChI key:InChIKey=YGBZFOQXPOGACY-CUDHKJQZSA-N
SMILES:C[C@@]12[C@]([C@](C(O)=O)(C)CCC1)(CCC(=C)[C@@H]2CC=C(C=C)C)[H]
Synonyms:- (+)-Communic acid
- (1S,4aR,5S,8aR)-Decahydro-1,4a-dimethyl-6-methylene-5-(3-methyl-2,4-pentadienyl)-1-naphthalenecarboxylic acid
- 1-Naphthalenecarboxylic acid, decahydro-1,4a-dimethyl-6-methylene-5-(3-methyl-2,4-pentadienyl)-, (1S,4aR,5S,8aR)-
- 1-Naphthalenecarboxylic acid, decahydro-1,4a-dimethyl-6-methylene-5-(3-methyl-2,4-pentadienyl)-, [1S-(1α,4aα,5α,8aβ)]-
- 1-Naphthalenecarboxylicacid, decahydro-1,4a-dimethyl-6-methylene-5-(3-methyl-2,4-pentadienyl)-, [1S-(1a,4aa,5a,8ab)]-
- Labda-8(20),12,14-trien-19-oic acid
- Labda-8(20),12,14-trien-19-oic acid (7CI,8CI)
- (1S,8aα)-Decahydro-1α,4aβ-dimethyl-6-methylene-5β-(3-methyl-2,4-pentadienyl)naphthalene-1β-carboxylic acid
- (1S,4aα)-Decahydro-1β-(3-methyl-2,4-pentadienyl)-2-methylene-5,8aβ-dimethylnaphthalene-5β-carboxylic acid
- 8(17),12,14-Labdatriene-19-oic acid
- (8aα)-1,4aβ-Dimethyl-5β-(3-methyl-2,4-pentadienyl)-6-methylenedecalin-1β-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Naphthalenecarboxylic acid, decahydro-1,4a-dimethyl-6-methylene-5-(3-methyl-2,4-pentadienyl)-, (1S,4aR,5S,8aR)-
CAS:Formula:C20H30O2Color and Shape:SolidMolecular weight:302.4510Communic acid
CAS:Communic acid has antibacterial activity, including against mycobacterial.
Formula:C20H30O2Purity:98%Color and Shape:SolidMolecular weight:302.45Communic Acid
CAS:Communic Acid is a naturally occurring diterpenoid resin acid, which is primarily derived from the resin of coniferous trees, particularly from the Pinaceae family. Its mode of action involves interacting with cellular membranes and proteins, potentially influencing signal transduction pathways and modulating cellular responses. This makes it a subject of interest in various biochemical and pharmacological studies.Formula:C20H30O2Purity:Min. 95%Molecular weight:302.45 g/mol



