
CAS 27610-12-4
:β-D-Glucopyranosiduronic acid, 17-oxoestra-1,3,5(10),7-tetraen-3-yl, monosodium salt
Description:
β-D-Glucopyranosiduronic acid, 17-oxoestra-1,3,5(10),7-tetraen-3-yl, monosodium salt, identified by CAS number 27610-12-4, is a complex organic compound that features both a glucuronic acid moiety and a steroidal structure derived from estradiol. The glucuronic acid component contributes to its solubility in water and its potential role in biological processes, such as detoxification and metabolism, as glucuronidation is a common pathway for drug metabolism. The steroidal part of the molecule suggests potential hormonal activity, which may influence various physiological processes. The presence of the monosodium salt indicates that the compound is likely to be more soluble in aqueous environments, enhancing its bioavailability. This compound may be of interest in pharmaceutical research, particularly in the context of drug design and development, due to its unique structural features that could interact with biological targets. Overall, its characteristics suggest a multifunctional role in both chemistry and biology, warranting further investigation into its applications.
Formula:C24H28O8·Na
InChI:InChI=1S/C24H28O8.Na/c1-24-9-8-14-13-5-3-12(10-11(13)2-4-15(14)16(24)6-7-17(24)25)31-23-20(28)18(26)19(27)21(32-23)22(29)30;/h3-5,10,14,16,18-21,23,26-28H,2,6-9H2,1H3,(H,29,30);/t14-,16+,18+,19+,20-,21+,23-,24+;/m1./s1
InChI key:InChIKey=QIPSWQQUVHTRPD-FWXKPSQYSA-N
SMILES:C[C@@]12[C@](C=3[C@@](C=4C(CC3)=CC(O[C@@H]5O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]5O)=CC4)(CC1)[H])(CCC2=O)[H].[Na]
Synonyms:- Estrane, β-D-glucopyranosiduronic acid deriv.
- Glucopyranosiduronic acid, 17-oxoestra-1,3,5(10),7-tetraen-3-yl, monosodium salt, β-D-
- β-D-Glucopyranosiduronic acid, 17-oxoestra-1,3,5(10),7-tetraen-3-yl, monosodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Equilin 3-O-β-D-Glucuronide Sodium Salt
CAS:Formula:C24H27O8·NaColor and Shape:White To Off-White SolidMolecular weight:443.47 22.99Equilin-d4 3-O-β-D-Glucuronide Sodium Salt - MOQ
CAS:Controlled ProductFormula:C24D4H23NaO8Color and Shape:NeatMolecular weight:470.481Equilin 3-O-β-D-Glucuronide Sodium Salt
CAS:Formula:C24H27NaO8Color and Shape:NeatMolecular weight:466.46Equilin 3-O-b-D-glucuronide sodium salt
CAS:Equilin 3-O-b-D-glucuronide sodium salt is a synthetic, monosaccharide that can be used as a raw material for various glycosylation reactions. This compound is an example of a fluorinated sugar. Equilin 3-O-b-D-glucuronide sodium salt has the CAS number 27610-12-4 and can be custom synthesized to order. It can be modified with a click reaction or other modification techniques to generate desired products. This product is available in high purity and can be used for glycosylation reactions.Formula:C24H27O8·NaPurity:Min. 95%Molecular weight:466.46 g/mol



