CAS 2762-59-6

N-phenylpiperidine-1-carbothioamide

Description:

N-phenylpiperidine-1-carbothioamide is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The compound features a phenyl group attached to the nitrogen atom of the piperidine, contributing to its aromatic properties. The carbothioamide functional group, which includes a carbonyl (C=O) and a thiol (S-H) component, is attached to the piperidine ring, influencing its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties can be influenced by the presence of the sulfur atom in the carbothioamide group, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. N-phenylpiperidine-1-carbothioamide may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₂H₁₆N₂S

InChI: InChI=1/C12H16N2S/c15-12(14-9-5-2-6-10-14)13-11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,13,15)

SMILES: c1ccc(cc1)N=C(N1CCCCC1)S

Synonyms:

• 1-piperidinecarbothioamide, N-phenyl-

N-Phenylpiperidine-1-carbothioamide

CAS: 2762-59-6

N-Phenylpiperidine-1-carbothioamide is a piperidine derivative. It has a crystal structure that is composed of phenyl and hydrogen bonds.

Formula: C₁₂H₁₆N₂S

Purity: Min. 95%

Molecular weight: 220.34 g/mol

Ref: 3D-CAA76259