CAS 27621-39-2
:Trithionic acid
Description:
Trithionic acid, with the CAS number 27621-39-2, is a chemical compound that belongs to the class of thionic acids, which are sulfur-containing acids. It is characterized by the presence of three sulfur atoms in its molecular structure, typically represented as H2S3O6. Trithionic acid is known for its relatively unstable nature and can exist in aqueous solutions. It is a weak acid, exhibiting properties similar to other thionic acids, and can participate in various chemical reactions, including oxidation and reduction processes. The compound is of interest in the study of sulfur chemistry and has potential applications in analytical chemistry and environmental science. Its behavior in solution can lead to the formation of various sulfur species, making it relevant in the context of sulfur cycle studies. However, due to its instability and the complexity of its chemistry, it is less commonly encountered compared to more stable sulfur compounds. Proper handling and storage conditions are essential to maintain its integrity for research purposes.
Formula:H2O6S3
InChI:InChI=1S/H2O6S3/c1-8(2,3)7-9(4,5)6/h(H,1,2,3)(H,4,5,6)
InChI key:InChIKey=KRURGYOKPVLRHQ-UHFFFAOYSA-N
SMILES:S(S(=O)(=O)O)S(=O)(=O)O
Synonyms:- Trithionic acid (H2S3O6)
- Trithionic acid
- Monosulfanedisulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
