CymitQuimica logo

CAS 276237-03-7

:

Pyridine,4-[5-(4-piperidinyl)-1,2,4-oxadiazol-3-yl]-

Description:
Pyridine, 4-[5-(4-piperidinyl)-1,2,4-oxadiazol-3-yl]- is a chemical compound characterized by its unique structure, which includes a pyridine ring and an oxadiazole moiety. The presence of the piperidine group enhances its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in polar solvents and may display basicity due to the nitrogen atoms in its structure. Its molecular framework suggests potential applications in pharmaceuticals, particularly as a scaffold for drug development targeting various biological pathways. The oxadiazole ring is known for its role in enhancing the pharmacological properties of compounds, including antimicrobial and anti-inflammatory activities. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyridine and oxadiazole rings, which may affect its interaction with biological targets. Overall, this compound represents a class of heterocyclic compounds that are valuable in the field of organic synthesis and drug discovery.
Formula:C12H14N4O
InChI:InChI=1S/C12H14N4O/c1-5-13-6-2-9(1)11-15-12(17-16-11)10-3-7-14-8-4-10/h1-2,5-6,10,14H,3-4,7-8H2
InChI key:OAAGDVLVOKMRCQ-UHFFFAOYSA-N
SMILES:C1CNCCC1C2=NC(=NO2)C3=CC=NC=C3
Found 4 products.