CAS 27644-32-2
:1,3,5-trimethylpiperidine
Description:
1,3,5-Trimethylpiperidine is a cyclic organic compound characterized by a piperidine ring with three methyl groups attached at the 1, 3, and 5 positions. This compound is a colorless to pale yellow liquid at room temperature and possesses a distinctive amine-like odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic methyl groups. The presence of the nitrogen atom in the piperidine ring imparts basic properties to the molecule, allowing it to participate in various chemical reactions, including alkylation and acylation. 1,3,5-Trimethylpiperidine is often used as a building block in organic synthesis and can serve as a ligand in coordination chemistry. Its unique structure and properties make it valuable in the development of pharmaceuticals and agrochemicals. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes, and appropriate safety measures should be taken during its use and storage.
Formula:C8H17N
InChI:InChI=1/C8H17N/c1-7-4-8(2)6-9(3)5-7/h7-8H,4-6H2,1-3H3
Synonyms:- piperidine, 1,3,5-trimethyl-
- 1,3,5-Trimethylpiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
