CAS 27647-84-3: zinc tetrahydrogen 4,4',4''-{5-[4-(dioxidomethylidene)cyclohexa-2,5-dien-1-ylidene]-5H-porphin-21-ide-10,15,20-triyl}tribenzoate
Description:Zinc tetrahydrogen 4,4',4''-{5-[4-(dioxidomethylidene)cyclohexa-2,5-dien-1-ylidene]-5H-porphin-21-ide-10,15,20-triyl}tribenzoate, with CAS number 27647-84-3, is a complex organic compound characterized by its porphyrin structure, which includes a zinc ion coordinated to a porphyrin ring. This compound features multiple functional groups, including benzoate moieties, which contribute to its solubility and reactivity. The presence of dioxidomethylidene and cyclohexa-2,5-dien-1-ylidene groups indicates potential for interesting electronic and photophysical properties, making it a candidate for applications in areas such as photodynamic therapy, catalysis, or as a dye. The intricate structure suggests that it may exhibit unique optical characteristics, including absorption and fluorescence properties, which are typical of porphyrin derivatives. Additionally, the zinc ion plays a crucial role in stabilizing the porphyrin framework and influencing the compound's overall reactivity and interaction with biological systems. Overall, this compound exemplifies the complexity and versatility of metalloporphyrins in chemical and biological applications.
Formula:C48H30N4O8Zn
InChI:InChI=1/C48H30N4O8.Zn/c53-45(54)29-9-1-25(2-10-29)38-23-37-22-35-18-17-33(49-35)21-34-19-20-36(50-34)24-39-40(26-3-11-30(12-4-26)46(55)56)41(27-5-13-31(14-6-27)47(57)58)44(52-39)42(43(38)51-37)28-7-15-32(16-8-28)48(59)60;/h1-24,49,52H,(H,53,54)(H,55,56)(H,57,58)(H,59,60);/q;+2/b33-21-,34-21-,35-22-,36-24-,37-22-,39-24-,43-42-,44-42-;
- Synonyms:
- benzoic acid, 4,4',4'',4'''-(21H,23H-porphine-2,3,5,7-tetrayl)tetrakis-, zinc salt (1:1)

Zincate(4-), [[4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl-κN21,κN22,κN23,κN24)tetrakis[benzoato]](6-)]-, hydrogen (1:4), (SP-4-1)-
Ref: IN-DA002UBN
1g | To inquire | ||
100mg | 194.00 € | ||
250mg | 316.00 € |

Ref: 54-IN11620
1g | 821.00 € | ||
100mg | 152.00 € | ||
250mg | 318.00 € |

Zn(II) meso-Tetra(4-carboxyphenyl) Porphine
Ref: FT-T40424
1g | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |