CAS 27648-26-6

1-phenyl-2-(tricyclo[3.3.1.1~3,7~]dec-1-yl)ethanone

Description:

1-Phenyl-2-(tricyclo[3.3.1.1^3,7]dec-1-yl)ethanone, with the CAS number 27648-26-6, is an organic compound characterized by its complex bicyclic structure. This substance features a phenyl group attached to a ketone functional group, which is further connected to a tricyclic decalin moiety. The presence of the ketone indicates that it has a carbonyl functional group (C=O), which contributes to its reactivity and potential applications in organic synthesis. The tricyclic structure adds to its rigidity and may influence its physical properties, such as melting and boiling points, as well as its solubility in various solvents. The compound may exhibit interesting biological activities due to its unique structural features, making it a subject of interest in medicinal chemistry. Additionally, its synthesis and characterization can provide insights into the behavior of similar compounds in chemical reactions. Overall, 1-phenyl-2-(tricyclo[3.3.1.1^3,7]dec-1-yl)ethanone represents a fascinating example of complex organic chemistry.

Formula: C₁₈H₂₂O

InChI: InChI=1/C18H22O/c19-17(16-4-2-1-3-5-16)12-18-9-13-6-14(10-18)8-15(7-13)11-18/h1-5,13-15H,6-12H2

SMILES: c1ccc(cc1)C(=O)CC12CC3CC(CC(C3)C2)C1

Synonyms:

• 2-(Adamantan-1-yl)-1-phenylethanone
• Ethanone, 1-phenyl-2-tricyclo[3.3.1.1~3,7~]dec-1-yl-

2-(Adamantan-1-yl)-1-phenylethanone

CAS: 27648-26-6

Formula: C₁₈H₂₂O

Molecular weight: 254.3667

Ref: IN-DA002UBM

2-(Adamantan-1-yl)-1-phenylethan-1-one

CAS: 27648-26-6

Adamantane derivatives are a class of organic molecules that are stable in the solid state but undergo rapid decomposition in solution. Adamantane derivatives with labile functional groups, such as 2-(Adamantan-1-yl)-1-phenylethan-1-one, can be used to study the interaction of radicals and metal salts. The photocyclization reaction of 2-(Adamantan-1-yl)-1-phenylethan-1-one has also been studied by irradiation. A number of synthetic methods exist for the preparation of this compound, including its synthesis from phenacyl bromide and an amine. 2-(Adamantan-1-yl)-1-phenylethan-1-one is insoluble in water and has a low solubility in other solvents. It is chiral, which means that it will have two nonidentical mirror images (enantiomers).

Formula: C₁₈H₂₂O

Purity: Min. 95%

Molecular weight: 254.4 g/mol

Ref: 3D-CBA64826