CAS 27649-43-0
:3-phenyl-1H-pyrrole
Description:
3-Phenyl-1H-pyrrole is an organic compound characterized by a pyrrole ring substituted with a phenyl group at the 3-position. The molecular structure consists of a five-membered nitrogen-containing heterocycle, which contributes to its aromatic properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic nature. 3-Phenyl-1H-pyrrole is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, owing to its ability to participate in various chemical reactions, including electrophilic aromatic substitution and cycloaddition. Additionally, it may exhibit interesting electronic properties due to the conjugation between the phenyl and pyrrole moieties, making it a subject of interest in materials science and organic electronics. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H9N
InChI:InChI=1/C10H9N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8,11H
SMILES:c1ccc(cc1)c1cc[nH]c1
Synonyms:- 1H-pyrrole, 3-phenyl-
- 3-Phenyl-1H-pyrrol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Phenyl-1H-pyrrole
CAS:3-Phenyl-1H-pyrrole is a haloalkyl that is used in the form of a reaction solution for electrochemical polymerization. The 3-phenyl-1H-pyrrole reacts with chlorine gas to form a chloride, which is then dehydrogenated to produce formamide. This process can be used as an alternative to microbicidal treatment. 3-Phenyl-1H-pyrrole has been shown to improve prostatic hypertrophy and bladder conditions when administrated in the form of an organic solvent.Formula:C10H9NPurity:Min. 95%Molecular weight:143.18 g/mol


