CAS 27653-67-4
:Trimethoprim 3-oxide
Description:
Trimethoprim 3-oxide, with the CAS number 27653-67-4, is a derivative of trimethoprim, a widely used antibiotic that inhibits bacterial dihydrofolate reductase. This compound is characterized by its structural modifications that enhance its pharmacological properties. Trimethoprim 3-oxide is typically a white to off-white crystalline solid, exhibiting moderate solubility in water and organic solvents. It possesses a molecular formula that reflects its nitrogen and oxygen content, which contributes to its biological activity. The compound is primarily studied for its potential antimicrobial effects and is often evaluated in the context of resistance mechanisms in bacteria. Its stability and reactivity can vary based on environmental conditions, making it important for researchers to consider these factors during experimentation. Additionally, the compound's safety profile and toxicity are essential for its application in clinical settings, necessitating thorough investigation in pharmacological studies. Overall, Trimethoprim 3-oxide represents a significant area of interest in medicinal chemistry and microbiology.
Formula:C14H18N4O4
InChI:InChI=1S/C14H18N4O4/c1-20-10-5-8(6-11(21-2)12(10)22-3)4-9-7-17-14(16)18(19)13(9)15/h5-7H,4,15H2,1-3H3,(H2,16,17)
InChI key:InChIKey=WDZLEQOJJCXUSW-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=C(CC=2C(N)=N(=O)C(N)=NC2)C=C1OC
Synonyms:- Pyrimidine, 2,4-diamino-5-(3,4,5-trimethoxybenzyl)-, 3-oxide
- Trimethoprim 3-N-oxide
- Trimethoprim 3-oxide
- 2,4-Diamino-5-(3,4,5-trimethoxybenzyl)pyrimidine 3-oxide
- 2,4-Pyrimidinediamine, 5-[(3,4,5-trimethoxyphenyl)methyl]-, 3-oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4-Pyrimidinediamine, 5-[(3,4,5-trimethoxyphenyl)methyl]-, 3-oxide
CAS:Formula:C14H18N4O4Color and Shape:SolidMolecular weight:306.3171(4-Trideuteromethoxy) Trimethoprim N3-Oxide
CAS:Controlled ProductFormula:C14D3H15N4O4Color and Shape:NeatMolecular weight:309.336Trimethoprim 3-N-Oxide
CAS:Controlled ProductFormula:C14H18N4O4Color and Shape:NeatMolecular weight:306.3171Trimethoprim 3-oxide
CAS:Trimethoprim 3-oxide trimethoprim primary metabolite.Formula:C14H18N4O4Purity:98%Color and Shape:SolidMolecular weight:306.32Trimethoprim 3-N-oxide
CAS:Trimethoprim 3-N-oxide is a metabolite of trimethoprim, which is used to treat urinary tract infections. It is excreted in the urine and its concentration can be measured by gas chromatography. Trimethoprim 3-N-oxide has been shown to inhibit bacterial growth in vitro and has been found to be effective against methicillin resistant Staphylococcus aureus (MRSA).Formula:C14H18N4O4Purity:Min. 95%Molecular weight:306.32 g/mol




