CymitQuimica logo

CAS 27656-72-0

:

6-amino-2-{[3-amino-N-(3-{[3-amino-3-(4-hydroxyphenyl)propanoyl]amino}-2-hydroxypropanoyl)alanyl]amino}-9-{[2-({3-[(4-aminobutyl)amino]propyl}amino)-2-oxoethyl]amino}-7-hydroxy-9-oxononanoic acid

Description:
The chemical substance known as "6-amino-2-{[3-amino-N-(3-{[3-amino-3-(4-hydroxyphenyl)propanoyl]amino}-2-hydroxypropanoyl)alanyl]amino}-9-{[2-({3-[(4-aminobutyl)amino]propyl}amino)-2-oxoethyl]amino}-7-hydroxy-9-oxononanoic acid" with CAS number 27656-72-0 is a complex organic compound characterized by multiple functional groups, including amino, hydroxyl, and carboxylic acid moieties. This structure suggests potential biological activity, possibly as a peptide or peptide-like molecule, which may interact with various biological systems. The presence of multiple amino acid residues indicates that it could play a role in protein synthesis or function. Its intricate structure may also imply specific solubility properties, stability under physiological conditions, and potential for forming hydrogen bonds, which are crucial for its biological interactions. Additionally, the compound's molecular weight and specific stereochemistry would influence its pharmacokinetics and pharmacodynamics if it were to be used in a therapeutic context. Overall, this substance exemplifies the complexity often found in biologically active molecules.
Formula:C33H58N10O10
InChI:InChI=1/C33H58N10O10/c34-11-1-2-12-38-13-4-14-39-30(49)19-41-29(48)16-26(45)22(36)5-3-6-24(33(52)53)42-31(50)25(17-35)43-32(51)27(46)18-40-28(47)15-23(37)20-7-9-21(44)10-8-20/h7-10,22-27,38,44-46H,1-6,11-19,34-37H2,(H,39,49)(H,40,47)(H,41,48)(H,42,50)(H,43,51)(H,52,53)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Edeine A1

    CAS:
    <p>Edeine A1 inhibits DNA replication and protein biosynthesis, exhibiting activity against Gram-positive and Gram-negative bacteria, fungi, and yeasts.</p>
    Formula:C33H58N10O10
    Color and Shape:Solid
    Molecular weight:754.875