CAS 2766-74-7
:5-Chloro-2-thiophenesulfonyl chloride
Description:
5-Chloro-2-thiophenesulfonyl chloride is an organosulfur compound characterized by the presence of a thiophene ring, a chlorine atom, and a sulfonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can undergo nucleophilic substitution reactions, making it useful in organic synthesis, especially in the preparation of sulfonamides and other derivatives. The chlorine atom at the 5-position of the thiophene ring enhances its electrophilic character, facilitating further chemical transformations. This compound is generally handled with care due to its potential to release hydrochloric acid upon reaction with water or alcohols, which can lead to corrosive effects. Additionally, it may pose health risks if inhaled or if it comes into contact with skin, necessitating appropriate safety measures during handling and storage. Overall, 5-Chloro-2-thiophenesulfonyl chloride is a valuable intermediate in the synthesis of various chemical entities in pharmaceutical and agrochemical research.
Formula:C4H2Cl2O2S2
InChI:InChI=1S/C4H2Cl2O2S2/c5-3-1-2-4(9-3)10(6,7)8/h1-2H
InChI key:InChIKey=SORSTNOXGOXWAO-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1SC(Cl)=CC1
Synonyms:- 2-Chloro-5-[$L^{2}-Chloranylidene(Dioxo)-$L^{7}-Sulfanyl]Thiophene
- 2-Chloro-5-chlorosulfonylthiophene
- 2-Chlorothiophene-5-sulfonyl chloride
- 2-Thiophenesulfonyl chloride, 5-chloro-
- 5-Chloro-2-thienylsulfonyl chloride
- 5-Chloro-2-thiophenesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chlorothiophene-2-sulfonyl chloride, 97%
CAS:5-Chlorothiophene-2-sulfonyl chloride is an important raw material and intermediate used in Organic Synthesis, Pharmaceuticals, Agrochemicals and Dyestuffs. It is used in the preparation of Notch-1-sparing -secretase inhibitors for the treatment of Alzheimer's disease. This Thermo Scientific ChemicaFormula:C4H2Cl2O2S2Purity:97%Color and Shape:Liquid, Clear colorless to pale yellow to yellow to brownMolecular weight:217.082-Thiophenesulfonyl chloride, 5-chloro-
CAS:Formula:C4H2Cl2O2S2Purity:95%Color and Shape:SolidMolecular weight:217.09355-Chlorothiophene-2-sulphonyl chloride
CAS:5-Chlorothiophene-2-sulphonyl chlorideFormula:C4H2Cl2O2S2Purity:95%Color and Shape: clear. light beige/light brown liquidMolecular weight:217.09g/mol5-Chloro-2-thiophenesulfonyl Chloride
CAS:Formula:C4H2Cl2O2S2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Yellow to Orange clear liquidMolecular weight:217.085-Chlorothiophene-2-sulfonyl chloride
CAS:Formula:C4H2Cl2O2S2Purity:95%Color and Shape:Solid, ClearMolecular weight:217.08




