CAS 27661-36-5
:Cyanidin 3-galactoside
Description:
Cyanidin 3-galactoside is a naturally occurring anthocyanin, a type of flavonoid pigment responsible for the red, purple, and blue colors in many fruits and vegetables. It is characterized by its glycosidic structure, where a galactose sugar is attached to the cyanidin aglycone at the 3-position. This compound is known for its antioxidant properties, contributing to the health benefits associated with the consumption of fruits and vegetables rich in anthocyanins. Cyanidin 3-galactoside is soluble in water and exhibits stability under acidic conditions, making it prevalent in various food products. Its presence is often linked to potential health benefits, including anti-inflammatory and cardioprotective effects. Additionally, it has been studied for its role in modulating cellular signaling pathways and its potential in preventing chronic diseases. The compound is commonly found in berries, red cabbage, and other plant sources, contributing to their vibrant coloration and nutritional value.
Formula:C21H21O11·Cl
InChI:InChI=1S/C21H20O11.ClH/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8;/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26);1H/t16-,17+,18+,19-,21-;/m1./s1
InChI key:InChIKey=YTMNONATNXDQJF-QSLGVYCOSA-N
SMILES:O(C=1C(=[O+]C2=C(C1)C(O)=CC(O)=C2)C3=CC(O)=C(O)C=C3)[C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O.[Cl-]
Synonyms:- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-3-(β-D-galactopyranosyloxy)-5,7-dihydroxy-, chloride
- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-3-(β-D-galactopyranosyloxy)-5,7-dihydroxy-, chloride (1:1)
- Idaein
- Idein
- Ideanin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Ideain chloride
CAS:Ideain chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C21H21O11ClPurity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:484.82Cyanidin-3-galactoside chloride
CAS:Formula:C21H21ClO11Purity:97%Color and Shape:SolidMolecular weight:484.8378Cyanidin-3-O-galactoside chloride
CAS:Cyanidin-3-O-galactoside chloridePurity:≥98%Molecular weight:484.84g/molCyanidin-3-O-galactoside chloride
CAS:Formula:C21H21ClO11MolWeightPurity:95%~99%Molecular weight:449.387Cyanidin 3-O-β-D-galactopyranoside chloride
CAS:<p>Cyanidin 3-O-β-D-galactopyranoside chloride</p>Formula:C21H21O11·ClPurity:98%Color and Shape: brown to black solidMolecular weight:484.84g/molCyanidin-3-O-Galactopyranoside Chloride (Idaein Chloride)
CAS:Formula:C21H21O11·ClMolecular weight:449.39 35.45Cyanidin 3-galactoside chloride
CAS:Natural glycosideFormula:C21H21O11ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:484.84Cyanidin-3-O-galactoside chloride
CAS:Cyanidin-3-O-galactoside chloride (Ideain chloride), extracted from hawthorn pericarp (EPHF), has antioxidant activity and can be used in obesity research.Formula:C21H21ClO11Purity:99.08% - 99.87%Color and Shape:SolidMolecular weight:484.84Cyanidin 3-O-β-D-Galactopyranoside Chloride
CAS:Controlled Product<p>Applications An anthocyanin responsible for red pigment in fruits and berries. It is an antioxidant, protecting the cell against damage from SOD.<br>References Riihinen, K., et al.: Food Chem., 110, 156 (2008), Khanizadeh, S., et al.: J. Food Comp. Anal., 21, 396 (2008), Viskelis, P., et al.: J. Food Sci., 74, C157 (2009), Comeskey, D., et al.: J. Agric. Food Chem., 57, 2035 (2009),<br></p>Formula:C21H21O11·ClColor and Shape:Dark Brown SolidMolecular weight:484.84Cyanidin-3-galactoside chloride
CAS:<p>Cyanidin-3-galactoside chloride is an anthocyanin, a type of flavonoid pigment, which is commonly derived from various fruits and vegetables, particularly those with red, purple, or blue hues such as berries and grapes. This compound exhibits potent antioxidant activity through its ability to scavenge free radicals, thereby reducing oxidative stress at the cellular level. By donating hydrogen atoms or electrons, Cyanidin-3-galactoside chloride can neutralize unstable molecules, which helps in preventing cellular damage.</p>Formula:C21H21ClO11Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:484.84 g/mol
