CAS 27665-39-0
:1,4-Butanedisulfonic acid
Description:
1,4-Butanedisulfonic acid, with the CAS number 27665-39-0, is an organic compound characterized by the presence of two sulfonic acid groups (-SO3H) attached to a four-carbon butane backbone. This compound is typically a white crystalline solid that is highly soluble in water, making it useful in various aqueous applications. Its sulfonic acid groups impart strong acidic properties, allowing it to act as a strong acid and a potential proton donor in chemical reactions. 1,4-Butanedisulfonic acid is often utilized as a reagent in organic synthesis, particularly in the preparation of sulfonate esters and as a catalyst in certain reactions. Additionally, it can serve as a surfactant or dispersing agent in various industrial applications. Due to its strong acidity and reactivity, proper handling and storage are essential to ensure safety and stability. Overall, 1,4-butanedisulfonic acid is a versatile compound with significant utility in both laboratory and industrial settings.
Formula:C4H10O6S2
InChI:InChI=1S/C4H10O6S2/c5-11(6,7)3-1-2-4-12(8,9)10/h1-4H2,(H,5,6,7)(H,8,9,10)
InChI key:InChIKey=VERAMNDAEAQRGS-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)CCCS(=O)(=O)O
Synonyms:- 1,4-Butane-disulfonate
- 1,4-Butanedisulfonate
- 1,4-Butanedisulfonic Acid, Ion(2-)
- 1,4-Butanedisulfonic acid
- 1,4-Disulfobutane
- Butane-1,4-Disulfonic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,4-Butanedisulfonic Acid
CAS:Hydrocarbon derivatives containing only sulfo groups, their salts andestersFormula:C4H10O6S2Color and Shape:White PowderMolecular weight:218.24Butane-1,4-disulfonic acid hydrate
CAS:Formula:C4H10O6S2Purity:98%Color and Shape:LiquidMolecular weight:218.2486Butane-1,4-disulfonic acid
CAS:<p>Butane-1,4-disulfonic acid</p>Purity:98-102%(contains 30-40%H2O)Molecular weight:218.25g/mol1,4-Butanedisulfonic Acid (contains ~40% water)
CAS:<p>Applications 1,4-Butanedisulfonic acid - (CAS# 27665-39-0) is a useful research chemical compound.<br></p>Formula:C4H10O6S2Color and Shape:ColourlessMolecular weight:218.251,4-Butanedisulfonic acid - 60% aqueous solution
CAS:<p>1,4-Butanedisulfonic acid is a polybasic organic compound that is used in the manufacture of S-adenosyl-L-methionine. It is also used as an organic solvent and as a reagent for the synthesis of linear growth inhibitors. 1,4-Butanedisulfonic acid can be dehydrated to give the alicyclic compound 1,4-butynediol. The molecule contains a formyl group that can react with nucleophiles such as amines or alcohols to form sulfonamides. It can also be used as a chromatographic mobile phase component. The molecule has transport properties that are dependent on its solubility and how it interacts with other compounds. It's carbon atom has four possible substitutions: two hydrogens, an alkynyl group, and a carbonyl group.</p>Formula:C4H10O6S2Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:218.25 g/mol






