CAS 27670-93-5
:2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E,38E,42E)-3,7,11,15,19,23,27,31,35,39,43,47-dodecamethyloctatetraconta-2,6,10,14,18,22,26,30,34,38,42,46-dodecaen-1-yl]-3-methylnaphthalene-1,4-dione
Description:
The chemical substance known as "2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E,38E,42E)-3,7,11,15,19,23,27,31,35,39,43,47-dodecamethyloctatetraconta-2,6,10,14,18,22,26,30,34,38,42,46-dodecaen-1-yl]-3-methylnaphthalene-1,4-dione," with the CAS number 27670-93-5, is a complex organic compound characterized by a large polyunsaturated hydrocarbon backbone and a naphthoquinone moiety. Its structure features multiple conjugated double bonds, which contribute to its potential optical properties and reactivity. The presence of the naphthalene ring system suggests that it may exhibit significant aromatic characteristics, including stability and potential for electron delocalization. The compound's extensive carbon chain may influence its physical properties, such as solubility and melting point, while the dione functional group indicates potential for redox activity. This compound may find applications in organic synthesis, materials science, or as a biological probe, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C71H104O2
InChI:InChI=1/C71H104O2/c1-54(2)28-17-29-55(3)30-18-31-56(4)32-19-33-57(5)34-20-35-58(6)36-21-37-59(7)38-22-39-60(8)40-23-41-61(9)42-24-43-62(10)44-25-45-63(11)46-26-47-64(12)48-27-49-65(13)52-53-67-66(14)70(72)68-50-15-16-51-69(68)71(67)73/h15-16,28,30,32,34,36,38,40,42,44,46,48,50-52H,17-27,29,31,33,35,37,39,41,43,45,47,49,53H2,1-14H3/b55-30+,56-32+,57-34+,58-36+,59-38+,60-40+,61-42+,62-44+,63-46+,64-48+,65-52+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Menaquinone 12
CAS:Menaquinone 12 (MK-12) is a human protein that belongs to the vitamin K family. It is essential for the synthesis of blood clotting proteins, such as prothrombin and factors VII, IX, and X. MK-12 has been shown to be involved in cellular signaling pathways that regulate cell growth and differentiation. MK-12 is a potent growth factor for many types of cancer cells, including breast cancer and prostate cancer cells.Formula:C71H104O2Purity:Min. 95%Molecular weight:989.58 g/mol




