CAS 2768-42-5
:(R)-3-Hydroxy-3-phenylpropionic acid
Description:
(R)-3-Hydroxy-3-phenylpropionic acid, with the CAS number 2768-42-5, is an organic compound characterized by its chiral structure, featuring a hydroxyl group and a phenyl group attached to a propionic acid backbone. This compound exists as a white to off-white crystalline solid and is soluble in water and organic solvents, making it versatile for various applications. Its chirality is significant in biochemical contexts, as it can exhibit different biological activities depending on its stereochemistry. The presence of the hydroxyl group contributes to its acidity, while the phenyl group enhances its hydrophobic characteristics. This compound is often studied in the context of pharmaceuticals and organic synthesis, where it can serve as an intermediate or a building block for more complex molecules. Additionally, its potential applications in the fields of medicinal chemistry and materials science highlight its importance in research and development. Overall, (R)-3-Hydroxy-3-phenylpropionic acid is a notable compound due to its unique structural features and functional properties.
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m1/s1
InChI key:InChIKey=AYOLELPCNDVZKZ-MRVPVSSYSA-N
SMILES:[C@H](CC(O)=O)(O)C1=CC=CC=C1
Synonyms:- (3R)-3-Hydroxy-3-phenylpropionic acid
- (3R)-3-hydroxy-3-phenylpropanoate
- (3R)-3-hydroxy-3-phenylpropanoic acid
- (R)-3-Hydroxy-3-phenylpropanoic acid
- (R)-3-Hydroxy-3-phenylpropanoicacid
- (R)-3-Hydroxybenzenepropanoic acid
- (βR)-β-Hydroxybenzenepropanoic acid
- <span class="text-smallcaps">D</span>(+)-β-Phenylhydracrylic acid
- Benzenepropanoic acid, β-hydroxy-, (R)-
- Benzenepropanoic acid, β-hydroxy-, (βR)-
- Hydrocinnamic acid, β-hydroxy-, (R)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(R)-(+)-3-Hydroxy-3-phenylpropionic acid, 98+%
CAS:It is employed in the synthesis and evaluation of a novel, reusable solid-supported open chain chiral auxiliary derived from m-hydrobenzoin for the diastereoselective reduction of -keto esters. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. SoFormula:C9H9O3Purity:98+%Color and Shape:White to pale cream, Crystals or powder or crystalline powder or fused solidMolecular weight:165.17(R)-(+)-3-Hydroxy-3-phenylpropionic acid
CAS:Formula:C9H10O3Purity:%Color and Shape:SolidMolecular weight:166.1739(3R)-3-Hydroxy-3-phenylpropanoic acid
CAS:(3R)-3-Hydroxy-3-phenylpropanoic acid is a fatty acid that is involved in the biosynthesis of erythroxylum. It has an innovative function for valorisation because it can be used to produce hydroxy fatty acids through a reaction with oleaginous materials. The synthesis of this compound is driven by the catalytic function of enzymes and the reaction system, which are made up of biocatalysts and substrates. The reaction products are compounds with a hydroxy group and an enantiomer. This process is catalyzed by esterases. The reactions take place at temperatures between 30°C and 50°C, with a pH range between 7 and 11.Formula:C9H10O3Purity:Min. 95%Molecular weight:166.17 g/mol



