
CAS 2768-94-7
:9-(2-Propyn-1-yl)-9H-fluorene
Description:
9-(2-Propyn-1-yl)-9H-fluorene, with the CAS number 2768-94-7, is an organic compound characterized by its unique structure, which features a fluorene backbone substituted with a propynyl group. This compound typically exhibits properties associated with aromatic hydrocarbons, including stability and a tendency to participate in electrophilic substitution reactions. Its molecular structure contributes to its potential applications in organic synthesis and materials science, particularly in the development of organic light-emitting diodes (OLEDs) and other electronic devices. The presence of the propynyl group can enhance its reactivity and solubility in various organic solvents. Additionally, due to its aromatic nature, it may display fluorescence properties, making it of interest in photonic applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 9-(2-Propyn-1-yl)-9H-fluorene represents a versatile compound in the field of organic chemistry.
Formula:C16H12
InChI:InChI=1S/C16H12/c1-2-7-12-13-8-3-5-10-15(13)16-11-6-4-9-14(12)16/h1,3-6,8-12H,7H2
InChI key:InChIKey=XXFLVFCBOHBKPQ-UHFFFAOYSA-N
SMILES:C(C#C)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- 9-(2-Propyn-1-yl)-9H-fluorene
- Fluorene, 9-(2-propynyl)-
- 9H-Fluorene, 9-(2-propynyl)-
- 9H-Fluorene, 9-(2-propyn-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.