CAS 276872-86-7
:1-Benzyloxycarbonylpyrrolidine-3-carboxaldehyde
Description:
1-Benzyloxycarbonylpyrrolidine-3-carboxaldehyde, identified by its CAS number 276872-86-7, is a chemical compound that features a pyrrolidine ring substituted with a benzyloxycarbonyl group and an aldehyde functional group. This compound is characterized by its structural complexity, which includes a five-membered nitrogen-containing ring, contributing to its potential biological activity. The presence of the benzyloxycarbonyl group enhances its stability and solubility, making it useful in various synthetic applications, particularly in the field of organic chemistry and medicinal chemistry. The aldehyde functional group is reactive, allowing for further chemical modifications and reactions, such as condensation or reduction. This compound may serve as an intermediate in the synthesis of more complex molecules, including pharmaceuticals. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 1-Benzyloxycarbonylpyrrolidine-3-carboxaldehyde is a versatile compound with potential applications in chemical synthesis and drug development.
Formula:C13H15NO3
InChI:InChI=1/C13H15NO3/c15-9-12-6-7-14(8-12)13(16)17-10-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2
SMILES:c1ccc(cc1)COC(=O)N1CCC(C1)C=O
Synonyms:- 1-Pyrrolidinecarboxylic acid, 3-formyl-, phenylmethyl ester
- Benzyl 3-formylpyrrolidine-1-carboxylate
- 3-Formyl-Pyrrolidine-1-Carboxylic Acid Benzyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzyloxycarbonylpyrrolidine-3-carboxaldehyde, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H15NO3Purity:97%Color and Shape:Clear yellow, Viscous liquidMolecular weight:233.271-Pyrrolidinecarboxylic acid, 3-formyl-, phenylmethyl ester
CAS:Formula:C13H15NO3Purity:97%Color and Shape:LiquidMolecular weight:233.2631Benzyl 3-formylpyrrolidine-1-carboxylate
CAS:Benzyl 3-formylpyrrolidine-1-carboxylatePurity:97%Molecular weight:233.26g/mol1-N-Cbz-3-Formyl-pyrrolidine
CAS:Formula:C13H15NO3Purity:97%Color and Shape:SolidMolecular weight:233.267



